missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methylene Blue, 1% Aqueous, Certified, LabChem™
$42.71 - $103.04
Chemical Identifiers
| CAS | 61-73-4 , 7732-18-5 |
|---|---|
| Molecular Formula | C16H18ClN3S |
| Molecular Weight (g/mol) | 319.851 |
| InChI Key | CXKWCBBOMKCUKX-UHFFFAOYSA-M |
| PubChem CID | 6099 |
| ChEBI | CHEBI:6872 |
| IUPAC Name | [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride |
| SMILES | CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2.[Cl-] |
Chemical Identifiers
| C16H18ClN3S | |
| CXKWCBBOMKCUKX-UHFFFAOYSA-M | |
| CHEBI:6872 | |
| CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2.[Cl-] |
Specifications
| Passes Test | |
| 99, 1 | |
| C16H18N3SCl | |
| Passes Test | |
| CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2.[Cl-] | |
| 319.851 | |
| CHEBI:6872 | |
| Certified | |
| Nitrogen oxides; Carbon monoxide; Carbon dioxide; Sulfur compounds | |
| Blue | |
| Methylene Blue, 1% Aqueous |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature