missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methylene Blue, 1% Aqueous, Certified, LabChem™
Supplier: LabChem LC169401
| Quantity | 500 mL |
|---|---|
| Packaging | Poly Bottle |
Chemical Identifiers
| C16H18ClN3S | |
| CXKWCBBOMKCUKX-UHFFFAOYSA-M | |
| CHEBI:6872 | |
| CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2.[Cl-] |
Specifications
| Methylene Blue | |
| 1% Aqueous | |
| 99, 1 | |
| C16H18N3SCl | |
| Passes Test | |
| CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2.[Cl-] | |
| 319.851 | |
| CHEBI:6872 | |
| Certified | |
| 1g/mL | |
| 1g/mL | |
| 500 mL |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature