missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methylene Blue, 1% Aqueous, Certified, LabChem™
Supplier: LabChem LC169401
Specifications
| Passes Test | |
| 1% Aqueous | |
| 99,1 | |
| C16H18N3SCl | |
| Passes Test | |
| CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2.[Cl-] | |
| 319.851 | |
| CHEBI:6872 | |
| Certified | |
| 1g/mL | |
| 1g/mL | |
| 500 mL |
| Methylene Blue | |
| 61-73-4,7732-18-5 | |
| C16H18ClN3S | |
| Soluble in water | |
| CXKWCBBOMKCUKX-UHFFFAOYSA-M | |
| [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride | |
| 6099 | |
| 319.85 | |
| Poly Bottle | |
| Nitrogen oxides; Carbon monoxide; Carbon dioxide; Sulfur compounds | |
| Blue | |
| Liquid |
Chemical Identifiers
| 61-73-4 | |
| 319.851 | |
| 6099 | |
| [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride |
| C16H18ClN3S | |
| CXKWCBBOMKCUKX-UHFFFAOYSA-M | |
| CHEBI:6872 | |
| CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2.[Cl-] |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature