missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methyl oleate, technical
CAS: 67762-38-3 | C19H36O2 | 296.50 g/mol
$80.65 - $455.87
Chemical Identifiers
| CAS | 67762-38-3 |
|---|---|
| Molecular Formula | C19H36O2 |
| Molecular Weight (g/mol) | 296.50 |
| MDL Number | MFCD00009578 |
| InChI Key | QYDYPVFESGNLHU-ZHACJKMWSA-N |
| Synonym | methyl oleate, oleic acid methyl ester, methyl cis-9-octadecenoate, oleic acid, methyl ester, edenor metio5, methyl z-9-octadecenoate, methyl-cis-oleate, exceparl m-ol, emery, oleic acid ester, esterol 112 |
| PubChem CID | 5364509 |
| ChEBI | CHEBI:27542 |
| IUPAC Name | methyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Qty | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Qty | ||||
|
AC414645000
|
Thermo Scientific Chemicals
414645000 |
500 g | Glass bottle |
Each for $80.65
|
|
||||
|
AC414640010
|
Thermo Scientific Chemicals
414640010 |
1 kg | Glass bottle |
Each for $142.69
|
|
||||
|
AC414640050
|
Thermo Scientific Chemicals
414640050 |
5 kg | Plastic drum |
Each for $455.87
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 67762-38-3 | |
| 296.50 | |
| QYDYPVFESGNLHU-ZHACJKMWSA-N | |
| 5364509 | |
| methyl (Z)-octadec-9-enoate |
| C19H36O2 | |
| MFCD00009578 | |
| methyl oleate, oleic acid methyl ester, methyl cis-9-octadecenoate, oleic acid, methyl ester, edenor metio5, methyl z-9-octadecenoate, methyl-cis-oleate, exceparl m-ol, emery, oleic acid ester, esterol 112 | |
| CHEBI:27542 | |
| CCCCCCCCC=CCCCCCCCC(=O)OC |
Specifications
| 67762-38-3 | |
| Yellow to Amber | |
| 186.0°C (9.0 mmHg) | |
| Authentic | |
| C19H36O2 | |
| CH3(CH2)7CHCH(CH2)7COOCH3 | |
| 500 g | |
| methyl oleate, oleic acid methyl ester, methyl cis-9-octadecenoate, oleic acid, methyl ester, edenor metio5, methyl z-9-octadecenoate, methyl-cis-oleate, exceparl m-ol, emery, oleic acid ester, esterol 112 | |
| QYDYPVFESGNLHU-ZHACJKMWSA-N | |
| methyl (Z)-octadec-9-enoate | |
| 5364509 | |
| CHEBI:27542 | |
| ≥55% | |
| Oily Liquid |
| -20.0°C | |
| 0.8700g/mL | |
| 180°C | |
| Glass bottle | |
| 1.4510 to 1.4580 | |
| MFCD00009578 | |
| 0.87 | |
| Solubility in water: insoluble. Other solubilities: soluble in most organic solvents | |
| CCCCCCCCC=CCCCCCCCC(=O)OC | |
| 296.50 | |
| 6.829 mPa.s (20°C) | |
| 296.48 | |
| Technical | |
| Methyl oleate |
Safety and Handling
EINECSNumber : 203-992-5
Recommended Storage : Refrigerator +4°C
RUO – Research Use Only