missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methyl linoleate, 99%
CAS: 112-63-0 | C19H34O2 | 294.48 g/mol
Supplier: Thermo Scientific Chemicals 428130250
| Quantity | 25 g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| C19H34O2 | |
| MFCD00009534 | |
| methyl linoleate, linoleic acid methyl ester, methyl lineoleate, methyl 9z,12z-octadeca-9,12-dienoate, methyl octadecadienoate, methyl 9-cis,12-cis-octadecadienoate, linoleic acid,methyl ester, linoleic acid, methyl ester, methyl linoleate, native, 9,12-octadecadienoic acid z,z-, methyl ester | |
| CHEBI:69080 | |
| CCCCCC=CCC=CCCCCCCCC(=O)OC |
Specifications
| Methyl linoleate | |
| -35.0°C | |
| 212.0°C (16.0 mmHg) | |
| 98.5% min. (GC) | |
| C19H34O2 | |
| 25 g | |
| 0.89 | |
| methyl linoleate, linoleic acid methyl ester, methyl lineoleate, methyl 9z,12z-octadeca-9,12-dienoate, methyl octadecadienoate, methyl 9-cis,12-cis-octadecadienoate, linoleic acid,methyl ester, linoleic acid, methyl ester, methyl linoleate, native, 9,12-octadecadienoic acid z,z-, methyl ester | |
| WTTJVINHCBCLGX-NQLNTKRDSA-N | |
| methyl (9Z,12Z)-octadeca-9,12-dienoate | |
| 5284421 | |
| 294.48 |
| 112-63-0 | |
| 0.8900g/mL | |
| >200°C | |
| Glass bottle | |
| CH3(CH2)4CH=CHCH2CH=CH(CH2)7CO2CH3 | |
| MFCD00009534 | |
| 15, 6167 | |
| Solubility in water: insoluble. Other solubilities: miscible with dmf,fat solvents,oils | |
| CCCCCC=CCC=CCCCCCCCC(=O)OC | |
| 294.48 | |
| CHEBI:69080 | |
| 99% |
Safety and Handling
EINECSNumber : 203-993-