missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methyl linoleate, 99%
CAS: 112-63-0 | C19H34O2 | 294.48 g/mol
$153.08 - $1425.73
Chemical Identifiers
| CAS | 112-63-0 |
|---|---|
| Molecular Formula | C19H34O2 |
| Molecular Weight (g/mol) | 294.48 |
| MDL Number | MFCD00009534 |
| InChI Key | WTTJVINHCBCLGX-NQLNTKRDSA-N |
| Synonym | methyl linoleate, linoleic acid methyl ester, methyl lineoleate, methyl 9z,12z-octadeca-9,12-dienoate, methyl octadecadienoate, methyl 9-cis,12-cis-octadecadienoate, linoleic acid,methyl ester, linoleic acid, methyl ester, methyl linoleate, native, 9,12-octadecadienoic acid z,z-, methyl esterShow More |
| PubChem CID | 5284421 |
| ChEBI | CHEBI:69080 |
| IUPAC Name | methyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC428130050
|
Thermo Scientific Chemicals
428130050 |
5 g | Glass bottle |
Each for $153.08
|
|
||||
|
AC428130250
|
Thermo Scientific Chemicals
428130250 |
25 g | Glass bottle |
Each for $501.85
|
|
||||
|
AC428131000
|
Thermo Scientific Chemicals
428131000 |
100 g | Glass bottle |
Each for $1,425.73
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 112-63-0 | |
| 294.48 | |
| WTTJVINHCBCLGX-NQLNTKRDSA-N | |
| 5284421 | |
| methyl (9Z,12Z)-octadeca-9,12-dienoate |
| C19H34O2 | |
| MFCD00009534 | |
| methyl linoleate, linoleic acid methyl ester, methyl lineoleate, methyl 9z,12z-octadeca-9,12-dienoate, methyl octadecadienoate, methyl 9-cis,12-cis-octadecadienoate, linoleic acid,methyl ester, linoleic acid, methyl ester, methyl linoleate, native, 9,12-octadecadienoic acid z,z-, methyl esterShow More | |
| CHEBI:69080 | |
| CCCCCC=CCC=CCCCCCCCC(=O)OC |
Specifications
| 112-63-0 | |
| 0.8900g/mL | |
| >200°C | |
| Glass bottle | |
| CH3(CH2)4CH=CHCH2CH=CH(CH2)7CO2CH3 | |
| 5 g | |
| 15, 6167 | |
| Solubility in water: insoluble. Other solubilities: miscible with dmf,fat solvents,oils | |
| CCCCCC=CCC=CCCCCCCCC(=O)OC | |
| 294.48 | |
| CHEBI:69080 | |
| 99% |
| -35.0°C | |
| 212.0°C (16.0 mmHg) | |
| 98.5% min. (GC) | |
| C19H34O2 | |
| MFCD00009534 | |
| 0.89 | |
| methyl linoleate, linoleic acid methyl ester, methyl lineoleate, methyl 9z,12z-octadeca-9,12-dienoate, methyl octadecadienoate, methyl 9-cis,12-cis-octadecadienoate, linoleic acid,methyl ester, linoleic acid, methyl ester, methyl linoleate, native, 9,12-octadecadienoic acid z,z-, methyl ester | |
| WTTJVINHCBCLGX-NQLNTKRDSA-N | |
| methyl (9Z,12Z)-octadeca-9,12-dienoate | |
| 5284421 | |
| 294.48 | |
| Methyl linoleate |
Safety and Handling
EINECSNumber : 203-993-
RUO – Research Use Only