missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methyl 6-bromo-2-naphthoate, 98%
CAS: 33626-98-1 | C12H9BrO2 | 265.1 g/mol
Supplier: Thermo Scientific Chemicals 364140050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Methyl 6-bromo-2-naphthoate | |
| 33626-98-1 | |
| Brown or Cream to White | |
| 97.5% min. (GC) | |
| C12H9BrO2 | |
| MFCD00100408 | |
| methyl 6-bromo-2-naphthoate, methyl6-bromo-2-naphthoate, 6-bromo-2-naphthalenecarboxylic acid methyl ester, 6-bromo-2-naphthoic acid methyl ester, 2-naphthalenecarboxylic acid, 6-bromo-, methyl ester, 6-bromonaphthalene-2-carboxylic acid methyl ester, 6-bromo-naphthalene-2-carboxylic acid methyl ester, pubchem9467, acmc-209i1z, 6-bromo-2-methylnaphthoate | |
| COC(=O)C1=CC2=C(C=C1)C=C(C=C2)Br | |
| 265.1 | |
| 265.1 | |
| Crystalline Powder |
| 98% | |
| 123.0°C to 126.0°C | |
| Authentic | |
| Glass bottle | |
| BrC10H6COOCH3 | |
| 5 g | |
| JEUBRLPXJZOGPX-UHFFFAOYSA-N | |
| methyl 6-bromonaphthalene-2-carboxylate | |
| 854134 | |
| 98% |
Chemical Identifiers
| 33626-98-1 | |
| 265.1 | |
| JEUBRLPXJZOGPX-UHFFFAOYSA-N | |
| methyl 6-bromonaphthalene-2-carboxylate |
| C12H9BrO2 | |
| MFCD00100408 | |
| 854134 | |
| COC(=O)C1=CC2=C(C=C1)C=C(C=C2)Br |
RUO – Research Use Only