missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methyl 3-nitrobenzoate, 98%
CAS: 618-95-1 | C8H7NO4 | 181.15 g/mol
$134.84 - $134.84
Chemical Identifiers
| CAS | 618-95-1 |
|---|---|
| Molecular Formula | C8H7NO4 |
| Molecular Weight (g/mol) | 181.15 |
| MDL Number | MFCD00007250 |
| InChI Key | AXLYJLKKPUICKV-UHFFFAOYSA-N |
| Synonym | 3-nitrobenzoic acid methyl ester, methyl m-nitrobenzoate, methyl3-nitrobenzoate, benzoic acid, 3-nitro-, methyl ester, m-nitrobenzoic acid, methyl ester, benzoic acid, m-nitro-, methyl ester, 3-nitro-benzoic acid methyl ester, 3-nitro-benzoicacimethylester, acmc-209mxc, methyl 3-nitro-benzoate |
| PubChem CID | 69260 |
| IUPAC Name | methyl 3-nitrobenzoate |
| SMILES | COC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC168441000
|
Thermo Scientific Chemicals
168441000 |
100 g | Plastic bottle |
Each for $134.84
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 618-95-1 | |
| 181.15 | |
| AXLYJLKKPUICKV-UHFFFAOYSA-N | |
| 69260 | |
| COC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
| C8H7NO4 | |
| MFCD00007250 | |
| 3-nitrobenzoic acid methyl ester, methyl m-nitrobenzoate, methyl3-nitrobenzoate, benzoic acid, 3-nitro-, methyl ester, m-nitrobenzoic acid, methyl ester, benzoic acid, m-nitro-, methyl ester, 3-nitro-benzoic acid methyl ester, 3-nitro-benzoicacimethylester, acmc-209mxc, methyl 3-nitro-benzoate | |
| methyl 3-nitrobenzoate |
Specifications
| 618-95-1 | |
| Beige | |
| Authentic | |
| Plastic bottle | |
| O2NC6H4CO2CH3 | |
| 100 g | |
| 10, 6435 | |
| Solubility in water: insoluble | |
| COC(=O)C1=CC(=CC=C1)[N+](=O)[O-] | |
| 181.15 | |
| 181.15 | |
| Crystalline Powder |
| 76°C to 80°C | |
| 279°C | |
| 97.5% min. (GC) | |
| C8H7NO4 | |
| MFCD00007250 | |
| 09, 378 | |
| 3-nitrobenzoic acid methyl ester, methyl m-nitrobenzoate, methyl3-nitrobenzoate, benzoic acid, 3-nitro-, methyl ester, m-nitrobenzoic acid, methyl ester, benzoic acid, m-nitro-, methyl ester, 3-nitro-benzoic acid methyl ester, 3-nitro-benzoicacimethylester, acmc-209mxc, methyl 3-nitro-benzoate | |
| AXLYJLKKPUICKV-UHFFFAOYSA-N | |
| methyl 3-nitrobenzoate | |
| 69260 | |
| 98% | |
| Methyl 3-nitrobenzoate |
Safety and Handling
EINECSNumber : 210-573-
RUO – Research Use Only