missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methyl 3-nitrobenzoate, 98%
CAS: 618-95-1 | C8H7NO4 | 181.15 g/mol
Supplier: Thermo Scientific Chemicals 168441000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Methyl 3-nitrobenzoate | |
| 76°C to 80°C | |
| 279°C | |
| 97.5% min. (GC) | |
| C8H7NO4 | |
| MFCD00007250 | |
| 09, 378 | |
| 3-nitrobenzoic acid methyl ester, methyl m-nitrobenzoate, methyl3-nitrobenzoate, benzoic acid, 3-nitro-, methyl ester, m-nitrobenzoic acid, methyl ester, benzoic acid, m-nitro-, methyl ester, 3-nitro-benzoic acid methyl ester, 3-nitro-benzoicacimethylester, acmc-209mxc, methyl 3-nitro-benzoate | |
| AXLYJLKKPUICKV-UHFFFAOYSA-N | |
| methyl 3-nitrobenzoate | |
| 69260 | |
| 98% |
| 618-95-1 | |
| Beige | |
| Authentic | |
| Plastic bottle | |
| O2NC6H4CO2CH3 | |
| 100 g | |
| 10, 6435 | |
| Solubility in water: insoluble | |
| COC(=O)C1=CC(=CC=C1)[N+](=O)[O-] | |
| 181.15 | |
| 181.15 | |
| Crystalline Powder |
Chemical Identifiers
| 618-95-1 | |
| 181.15 | |
| AXLYJLKKPUICKV-UHFFFAOYSA-N | |
| 69260 | |
| COC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
| C8H7NO4 | |
| MFCD00007250 | |
| 3-nitrobenzoic acid methyl ester, methyl m-nitrobenzoate, methyl3-nitrobenzoate, benzoic acid, 3-nitro-, methyl ester, m-nitrobenzoic acid, methyl ester, benzoic acid, m-nitro-, methyl ester, 3-nitro-benzoic acid methyl ester, 3-nitro-benzoicacimethylester, acmc-209mxc, methyl 3-nitro-benzoate | |
| methyl 3-nitrobenzoate |
Safety and Handling
EINECSNumber : 210-573-
RUO – Research Use Only