missing translation for 'onlineSavingsMsg'
Learn More
Learn More
m-Nitroacetophenone, 98%
CAS: 121-89-1 | C8H7NO3 | 165.15 g/mol
Supplier: Thermo Scientific Chemicals 128331000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| m-Nitroacetophenone | |
| 121-89-1 | |
| 100.0 | |
| 201.0°C to 203.0°C | |
| 97.5% min. (GC) | |
| C8H7NO3 | |
| MFCD00007259 | |
| 07, 288 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol | |
| CC(=O)C1=CC(=CC=C1)[N+](=O)[O-] | |
| 165.15 | |
| 165.15 | |
| Crystalline Powder |
| 98% | |
| 97.5 | |
| 76.0°C to 79.0°C | |
| Authentic | |
| Plastic bottle | |
| O2NC6H4COCH3 | |
| 100 g | |
| 3'-nitroacetophenone, 3-nitroacetophenone, m-nitroacetophenone, 1-3-nitrophenyl ethanone, ethanone, 1-3-nitrophenyl, acetophenone, 3'-nitro, m-acetylnitrobenzene, usaf ma-1, methyl 3-nitrophenyl ketone, 3-nitroacetofenon | |
| ARKIFHPFTHVKDT-UHFFFAOYSA-N | |
| 1-(3-nitrophenyl)ethanone | |
| 8494 | |
| 98% |
Chemical Identifiers
| 121-89-1 | |
| 165.15 | |
| ARKIFHPFTHVKDT-UHFFFAOYSA-N | |
| 8494 | |
| CC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
| C8H7NO3 | |
| MFCD00007259 | |
| 3'-nitroacetophenone, 3-nitroacetophenone, m-nitroacetophenone, 1-3-nitrophenyl ethanone, ethanone, 1-3-nitrophenyl, acetophenone, 3'-nitro, m-acetylnitrobenzene, usaf ma-1, methyl 3-nitrophenyl ketone, 3-nitroacetofenon | |
| 1-(3-nitrophenyl)ethanone |
Safety and Handling
EINECSNumber : 204-504-3
RTECSNumber : AM9625000
TSCA : TSCA
RUO – Research Use Only