missing translation for 'onlineSavingsMsg'
Learn More
Learn More
m-Nitroacetophenone, 98%
CAS: 121-89-1 | C8H7NO3 | 165.15 g/mol
$66.42 - $154.17
Chemical Identifiers
| CAS | 121-89-1 |
|---|---|
| Molecular Formula | C8H7NO3 |
| Molecular Weight (g/mol) | 165.15 |
| MDL Number | MFCD00007259 |
| InChI Key | ARKIFHPFTHVKDT-UHFFFAOYSA-N |
| Synonym | 3'-nitroacetophenone, 3-nitroacetophenone, m-nitroacetophenone, 1-3-nitrophenyl ethanone, ethanone, 1-3-nitrophenyl, acetophenone, 3'-nitro, m-acetylnitrobenzene, usaf ma-1, methyl 3-nitrophenyl ketone, 3-nitroacetofenon |
| PubChem CID | 8494 |
| IUPAC Name | 1-(3-nitrophenyl)ethanone |
| SMILES | CC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC128331000
|
Thermo Scientific Chemicals
128331000 |
100 g | Plastic bottle |
Each for $66.42
|
|
||||
|
AC128335000
|
Thermo Scientific Chemicals
128335000 |
500 g | Plastic bottle |
Each for $154.17
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 121-89-1 | |
| 165.15 | |
| ARKIFHPFTHVKDT-UHFFFAOYSA-N | |
| 8494 | |
| CC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
| C8H7NO3 | |
| MFCD00007259 | |
| 3'-nitroacetophenone, 3-nitroacetophenone, m-nitroacetophenone, 1-3-nitrophenyl ethanone, ethanone, 1-3-nitrophenyl, acetophenone, 3'-nitro, m-acetylnitrobenzene, usaf ma-1, methyl 3-nitrophenyl ketone, 3-nitroacetofenon | |
| 1-(3-nitrophenyl)ethanone |
Specifications
| 121-89-1 | |
| 100.0 | |
| 201.0°C to 203.0°C | |
| 97.5% min. (GC) | |
| C8H7NO3 | |
| MFCD00007259 | |
| 07, 288 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol | |
| CC(=O)C1=CC(=CC=C1)[N+](=O)[O-] | |
| 165.15 | |
| 165.15 | |
| Crystalline Powder |
| 97.5 | |
| 76.0°C to 79.0°C | |
| Authentic | |
| Plastic bottle | |
| O2NC6H4COCH3 | |
| 100 g | |
| 3'-nitroacetophenone, 3-nitroacetophenone, m-nitroacetophenone, 1-3-nitrophenyl ethanone, ethanone, 1-3-nitrophenyl, acetophenone, 3'-nitro, m-acetylnitrobenzene, usaf ma-1, methyl 3-nitrophenyl ketone, 3-nitroacetofenon | |
| ARKIFHPFTHVKDT-UHFFFAOYSA-N | |
| 1-(3-nitrophenyl)ethanone | |
| 8494 | |
| 98% | |
| m-Nitroacetophenone, 98% |
Safety and Handling
EINECSNumber : 204-504-3
RTECSNumber : AM9625000
TSCA : TSCA
RUO – Research Use Only