missing translation for 'onlineSavingsMsg'
Learn More
Learn More
LiChropur™ N-Isobutyryl-L-cysteine, For Chiral Derivatization, 97.0%, MilliporeSigma™ Supelco™
Chiral derivatizing agent employed in the assay of the enantiomeric purity of amino acids with OPA
Supplier: Merck Emd Millipore 586981GF
Specifications
| 124529-02-8 | |
| Bottomless Glass Bottle with Fused Cone | |
| C7H13NO3S | |
| 1 g | |
| BWBQXMAXLAHHTK-YFKPBYRVSA-N | |
| (2R)-2-(2-methylpropanamido)-3-sulfanylpropanoic acid | |
| 191.25 | |
| For chiral derivatization |
| 97°C to 101°C | |
| C7H13NO3S | |
| MFCD00155635 | |
| N-(2-Methylpropionyl)-L-cysteine | |
| CC(C)C(=O)N[C@@H](CS)C(O)=O | |
| 191.25 | |
| ≥97.0% |
Chemical Identifiers
| 124529-02-8 | |
| 191.25 | |
| BWBQXMAXLAHHTK-YFKPBYRVSA-N | |
| (2R)-2-(2-methylpropanamido)-3-sulfanylpropanoic acid |
| C7H13NO3S | |
| MFCD00155635 | |
| N-(2-Methylpropionyl)-L-cysteine | |
| CC(C)C(=O)N[C@@H](CS)C(O)=O |
LiChropur is a trademark of Merck KGaA, Darmstadt, Germany