missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Menthol, Crystal, USP, 98-102%, Spectrum™ Chemical
ME110, 2216-51-5, C10H20O
Supplier: Spectrum Chemical Mfg Cor ME110500GM
| Quantity | 500 g |
|---|---|
| Packaging | Amber Glass Bottle |
Description
Spectrum™ Chemical L-Menthol, Crystal, USP is used as a local anesthetic, a counterirritant and can help relieve minor throat irritations. All Spectrum Chemical USP products are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Chemical Identifiers
| 2216-51-5 | |
| 156.27 | |
| (1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexan-1-ol |
| C10H20O | |
| NOOLISFMXDJSKH-KXUCPTDWSA-N | |
| CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O |
Specifications
| L-Menthol | |
| 100% | |
| Amber Glass Bottle | |
| 500 g | |
| NOOLISFMXDJSKH-KXUCPTDWSA-N | |
| (1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexan-1-ol | |
| 98 to 102% | |
| Crystalline Powder or Lumps |
| 2216-51-5 | |
| 41-44°C | |
| C10H20O | |
| -45° to -51° | |
| CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O | |
| 156.27 | |
| USP |