missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L(-)-Mannose, 99+%
CAS: 10030-80-5 | C6H12O6 | 180.16 g/mol
Supplier: Thermo Scientific Chemicals 227592500
| Quantity | 250 mg |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 10030-80-5 | |
| 180.16 | |
| GZCGUPFRVQAUEE-BXKVDMCESA-N | |
| 82308 | |
| (2R,3R,4S,5S)-2,3,4,5,6-pentahydroxyhexanal |
| C6H12O6 | |
| MFCD00136021 | |
| l-mannose, l---mannose, aldehydo-l-mannose, mannose, l, 2r,3r,4s,5s-2,3,4,5,6-pentahydroxyhexanal, unii-2w3ye50tx8, aldehydo-l-manno-hexose, l-?-mannose | |
| CHEBI:37681 | |
| OC[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C=O |
Specifications
| L(-)-Mannose | |
| 129.0°C to 131.0°C | |
| 0.1% max. | |
| Authentic | |
| Glass bottle | |
| 250 mg | |
| −14.70° (20°C c=4,H2O,NH3) | |
| − 14.70 | |
| GZCGUPFRVQAUEE-BXKVDMCESA-N | |
| (2R,3R,4S,5S)-2,3,4,5,6-pentahydroxyhexanal | |
| 82308 | |
| 180.16 | |
| Powder |
| 10030-80-5 | |
| White | |
| 0.5% max. (60° to 70°C) | |
| 99% min. (ELSD) (HPLC) | |
| C6H12O6 | |
| MFCD00136021 | |
| l-mannose, l---mannose, aldehydo-l-mannose, mannose, l, 2r,3r,4s,5s-2,3,4,5,6-pentahydroxyhexanal, unii-2w3ye50tx8, aldehydo-l-manno-hexose, l-?-mannose | |
| Solubility in water: soluble. Other solubilities: slightly soluble in alcohol,insoluble in ether | |
| OC[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C=O | |
| 180.16 | |
| CHEBI:37681 | |
| 99+% |
Safety and Handling
EINECSNumber : 233-080-2