missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Aspartic acid β-benzyl ester, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 441930050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| L-Aspartic acid β-benzyl ester | |
| Authentic | |
| C11H13NO4 | |
| + 27.8 | |
| VGALFAWDSNRXJK-VIFPVBQESA-N | |
| (2S)-2-amino-4-oxo-4-phenylmethoxybutanoic acid | |
| 101186 | |
| 98% |
| 2177-63-1 | |
| 97.5% min. (HPLC) | |
| 5g | |
| h-asp obzl-oh, l-aspartic acid 4-benzyl ester, l-aspartic acid beta-benzyl ester, beta-benzyl l-aspartate, 2s-2-amino-4-benzyloxy-4-oxobutanoic acid, 4-benzyl l-aspartate, benzyl hydrogen beta-l-aspartate, s-2-amino-4-benzyloxy-4-oxobutanoic acid, 2s-2-amino-4-oxo-4-phenylmethoxybutanoic acid, asp obzl | |
| C1=CC=C(C=C1)COC(=O)CC(C(=O)O)N | |
| 223.23 | |
| 223.23 |
Chemical Identifiers
| 2177-63-1 | |
| 223.23 | |
| h-asp obzl-oh, l-aspartic acid 4-benzyl ester, l-aspartic acid beta-benzyl ester, beta-benzyl l-aspartate, 2s-2-amino-4-benzyloxy-4-oxobutanoic acid, 4-benzyl l-aspartate, benzyl hydrogen beta-l-aspartate, s-2-amino-4-benzyloxy-4-oxobutanoic acid, 2s-2-amino-4-oxo-4-phenylmethoxybutanoic acid, asp obzl | |
| (2S)-2-amino-4-oxo-4-phenylmethoxybutanoic acid |
| C11H13NO4 | |
| VGALFAWDSNRXJK-VIFPVBQESA-N | |
| 101186 | |
| C1=CC=C(C=C1)COC(=O)CC(C(=O)O)N |
Safety and Handling
EINECSNumber : 218-541-8
RUO â Research Use Only