missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Inosine, 99%
CAS: 58-63-9 | C10H12N4O5 | 268.23 g/mol
Supplier: Thermo Scientific Chemicals 122250250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Inosine | |
| 1.65 to 1.77 (A250/A260), 0.22 to 0.26 (A280/A260) | |
| White | |
| Authentic | |
| Glass bottle | |
| MFCD00066770 | |
| 31, 25 | |
| − 49.20 (18.00°C c=1,H2O) | |
| inosine, hypoxanthosine, ribonosine, atorel, oxiamin, trophicardyl, selfer, pantholic-l, panholic-l, hypoxanthine riboside | |
| 98 to 102% (lambda max. 248.5nm,pH 7) Molar absorptivity 12200+/-2%,on dry substance | |
| OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=NC2=C1N=CNC2=O | |
| 98% min. (c=1, H2O, 430nm, 1cm cell) | |
| 6021 | |
| 268.22 | |
| Crystalline Powder |
| 58-63-9 | |
| 212°C to 213°C | |
| 1% max. | |
| 98.5% min. (HPLC) | |
| C10H12N4O5 | |
| 25 g | |
| 15, 5018 | |
| -49.2 | |
| Solubility in water: 2.1g/100 mL (20°C). Other solubilities: soluble in ethanol | |
| UGQMRVRMYYASKQ-YPLCUDRINA-N | |
| 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one | |
| 268.23 | |
| CHEBI:17596 | |
| 99% |
Chemical Identifiers
| 58-63-9 | |
| 268.23 | |
| UGQMRVRMYYASKQ-YPLCUDRINA-N | |
| 6021 | |
| 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one |
| C10H12N4O5 | |
| MFCD00066770 | |
| inosine, hypoxanthosine, ribonosine, atorel, oxiamin, trophicardyl, selfer, pantholic-l, panholic-l, hypoxanthine riboside | |
| CHEBI:17596 | |
| OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=NC2=C1N=CNC2=O |
Safety and Handling
EINECSNumber : 200-390-4
RUO – Research Use Only