missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Hydroxy Naphthol Blue, disodium salt, ACS reagent
CAS: 165660-27-5 | C20H12N2Na2O11S3 | 600.495 g/mol
$52.05 - $257.12
Chemical Identifiers
| CAS | 165660-27-5 |
|---|---|
| Molecular Formula | C20H12N2Na2O11S3 |
| Molecular Weight (g/mol) | 600.495 |
| MDL Number | MFCD00004075 |
| InChI Key | LXJHFXHZWYBBKJ-LUUCHEBKSA-N |
| Synonym | 2,2'-Dihydroxy-1,1'-azonaphthalene-3',4,6'-trisulfonic acid disodium salt |
| PubChem CID | 131849366 |
| IUPAC Name | 3-hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1-ylidene)hydrazinyl]naphthalene-2,7-disulfonic acid;sodium |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)C2=NNC3=C4C=CC(=CC4=CC(=C3O)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O.[Na].[Na] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC204880050
|
Thermo Scientific Chemicals
204880050 |
5 g | Glass bottle |
Each for $52.05
|
|
||||
|
AC204881000
|
Thermo Scientific Chemicals
204881000 |
100 g | Glass Bottle |
Each for $257.12
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 165660-27-5 | |
| 600.495 | |
| LXJHFXHZWYBBKJ-LUUCHEBKSA-N | |
| 131849366 | |
| C1=CC=C2C(=C1)C(=CC(=O)C2=NNC3=C4C=CC(=CC4=CC(=C3O)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O.[Na].[Na] |
| C20H12N2Na2O11S3 | |
| MFCD00004075 | |
| 2,2'-Dihydroxy-1,1'-azonaphthalene-3',4,6'-trisulfonic acid disodium salt | |
| 3-hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1-ylidene)hydrazinyl]naphthalene-2,7-disulfonic acid;sodium |
Specifications
| 274.0°C | |
| C20H12N2Na2O11S3 | |
| 2,2'-Dihydroxy-1,1'-azonaphthalene-3',4,6'-trisulfonic acid disodium salt | |
| LXJHFXHZWYBBKJ-LUUCHEBKSA-N | |
| C1=CC=C2C(=C1)C(=CC(=O)C2=NNC3=C4C=CC(=CC4=CC(=C3O)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O.[Na].[Na] | |
| 600.495 | |
| 598.47 | |
| Glass bottle | |
| Blue to Purple | |
| Crystalline Powder or Crystals |
| 165660-27-5 | |
| MFCD00004075 | |
| Solubility in water: soluble. | |
| Authentic | |
| 3-hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1-ylidene)hydrazinyl]naphthalene-2,7-disulfonic acid;sodium | |
| 131849366 | |
| ACS Reagent | |
| (for calcium determination) passes | |
| 5 g | |
| Hydroxy Naphthol Blue, disodium salt |
Safety and Handling
Recommended Storage : Room tempature
RUO – Research Use Only