missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Hydroxy Naphthol Blue, disodium salt, ACS reagent
CAS: 165660-27-5 | C20H12N2Na2O11S3 | 600.495 g/mol
Supplier: Thermo Scientific Chemicals 204880050
| Quantity | 5 g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 165660-27-5 | |
| 600.495 | |
| LXJHFXHZWYBBKJ-LUUCHEBKSA-N | |
| 131849366 | |
| C1=CC=C2C(=C1)C(=CC(=O)C2=NNC3=C4C=CC(=CC4=CC(=C3O)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O.[Na].[Na] |
| C20H12N2Na2O11S3 | |
| MFCD00004075 | |
| 2,2'-Dihydroxy-1,1'-azonaphthalene-3',4,6'-trisulfonic acid disodium salt | |
| 3-hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1-ylidene)hydrazinyl]naphthalene-2,7-disulfonic acid;sodium |
Specifications
| Hydroxy Naphthol Blue, disodium salt | |
| 165660-27-5 | |
| MFCD00004075 | |
| Solubility in water: soluble. | |
| C1=CC=C2C(=C1)C(=CC(=O)C2=NNC3=C4C=CC(=CC4=CC(=C3O)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O.[Na].[Na] | |
| 3-hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1-ylidene)hydrazinyl]naphthalene-2,7-disulfonic acid;sodium | |
| 131849366 | |
| ACS Reagent | |
| (for calcium determination) passes | |
| 5 g |
| 274.0°C | |
| C20H12N2Na2O11S3 | |
| 2,2'-Dihydroxy-1,1'-azonaphthalene-3',4,6'-trisulfonic acid disodium salt | |
| LXJHFXHZWYBBKJ-LUUCHEBKSA-N | |
| Authentic | |
| 600.495 | |
| 598.47 | |
| Glass bottle | |
| Blue to Purple | |
| Crystalline Powder or Crystals |
Safety and Handling
Recommended Storage : Room tempature