missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Hexamethylbenzene, 98+%
CAS: 87-85-4 | C12H18 | 162.27 g/mol
Supplier: Thermo Scientific Chemicals 120570050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Hexamethylbenzene | |
| 87-85-4 | |
| White to Yellow | |
| Authentic | |
| Glass bottle | |
| C6(CH3)6 | |
| 5 g | |
| 01,426; 01,427; 02,207; 05,323; 06,273; 07,167; 09,234; 13,141; 14,175 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol | |
| CC1=C(C(=C(C(=C1C)C)C)C)C | |
| 162.27 | |
| CHEBI:39001 | |
| 98+% |
| 99+% | |
| 165°C to 168°C | |
| 264°C | |
| 98% min. (GC) | |
| C12H18 | |
| MFCD00008523 | |
| 05, 450 | |
| hexamethylbenzene, mellitene, benzene, hexamethyl, hexamethylbenzol, hexamethyl benzene, unii-j8sd5741v8, 1,2,3,4,5,6-hexamethyl-benzene, benzene, 1,2,3,4,5,6-hexamethyl, hexamethyl-benzene, hexamethylbenxene; | |
| YUWFEBAXEOLKSG-UHFFFAOYSA-N | |
| 1,2,3,4,5,6-hexamethylbenzene | |
| 6908 | |
| 162.27 | |
| Crystalline Powder, Crystals or Needles |
Chemical Identifiers
| 87-85-4 | |
| 162.27 | |
| YUWFEBAXEOLKSG-UHFFFAOYSA-N | |
| 6908 | |
| 1,2,3,4,5,6-hexamethylbenzene |
| C12H18 | |
| MFCD00008523 | |
| hexamethylbenzene, mellitene, benzene, hexamethyl, hexamethylbenzol, hexamethyl benzene, unii-j8sd5741v8, 1,2,3,4,5,6-hexamethyl-benzene, benzene, 1,2,3,4,5,6-hexamethyl, hexamethyl-benzene, hexamethylbenxene; | |
| CHEBI:39001 | |
| CC1=C(C(=C(C(=C1C)C)C)C)C |
Safety and Handling
EINECSNumber : 201-777-0
RTECSNumber : DA3200000
TSCA : TSCA
RUO – Research Use Only