missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Hexamethylbenzene, 98+%
CAS: 87-85-4 | C12H18 | 162.27 g/mol
$167.18 - $644.46
Chemical Identifiers
| CAS | 87-85-4 |
|---|---|
| Molecular Formula | C12H18 |
| Molecular Weight (g/mol) | 162.27 |
| MDL Number | MFCD00008523 |
| InChI Key | YUWFEBAXEOLKSG-UHFFFAOYSA-N |
| Synonym | hexamethylbenzene, mellitene, benzene, hexamethyl, hexamethylbenzol, hexamethyl benzene, unii-j8sd5741v8, 1,2,3,4,5,6-hexamethyl-benzene, benzene, 1,2,3,4,5,6-hexamethyl, hexamethyl-benzene, hexamethylbenxene; |
| PubChem CID | 6908 |
| ChEBI | CHEBI:39001 |
| IUPAC Name | 1,2,3,4,5,6-hexamethylbenzene |
| SMILES | CC1=C(C(=C(C(=C1C)C)C)C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC120570050
|
Thermo Scientific Chemicals
120570050 |
5 g | Glass bottle |
Each for $167.18
|
|
||||
|
AC120570250
|
Thermo Scientific Chemicals
120570250 |
25 g | Glass bottle |
Each for $644.46
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 87-85-4 | |
| 162.27 | |
| YUWFEBAXEOLKSG-UHFFFAOYSA-N | |
| 6908 | |
| 1,2,3,4,5,6-hexamethylbenzene |
| C12H18 | |
| MFCD00008523 | |
| hexamethylbenzene, mellitene, benzene, hexamethyl, hexamethylbenzol, hexamethyl benzene, unii-j8sd5741v8, 1,2,3,4,5,6-hexamethyl-benzene, benzene, 1,2,3,4,5,6-hexamethyl, hexamethyl-benzene, hexamethylbenxene; | |
| CHEBI:39001 | |
| CC1=C(C(=C(C(=C1C)C)C)C)C |
Specifications
| 87-85-4 | |
| White to Yellow | |
| Authentic | |
| Glass bottle | |
| C6(CH3)6 | |
| 5 g | |
| 01,426; 01,427; 02,207; 05,323; 06,273; 07,167; 09,234; 13,141; 14,175 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol | |
| CC1=C(C(=C(C(=C1C)C)C)C)C | |
| 162.27 | |
| CHEBI:39001 | |
| 98+% | |
| Hexamethylbenzene, 99+% |
| 165°C to 168°C | |
| 264°C | |
| 98% min. (GC) | |
| C12H18 | |
| MFCD00008523 | |
| 05, 450 | |
| hexamethylbenzene, mellitene, benzene, hexamethyl, hexamethylbenzol, hexamethyl benzene, unii-j8sd5741v8, 1,2,3,4,5,6-hexamethyl-benzene, benzene, 1,2,3,4,5,6-hexamethyl, hexamethyl-benzene, hexamethylbenxene; | |
| YUWFEBAXEOLKSG-UHFFFAOYSA-N | |
| 1,2,3,4,5,6-hexamethylbenzene | |
| 6908 | |
| 162.27 | |
| Crystalline Powder, Crystals or Needles |
Safety and Handling
EINECSNumber : 201-777-0
RTECSNumber : DA3200000
TSCA : TSCA
RUO – Research Use Only