Learn More
HEPES Sodium Salt (White Powder), Fisher BioReagents
Supplier: Fisher BioReagents FLBP4101
Description
HEPES Sodium Salt is used as a buffer for in vitro cell culture.Specifications
| 0.04 max. (0.1M in water, 1cm) at 260nm, 0.02 max. (0.1M in water, 1cm) at 280nm | |
| 75277-39-3 | |
| Powder or Solid | |
| Pass Test | |
| 3.0% max. | |
| MFCD00036463 | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate | |
| 2724248 | |
| 260.29 |
| HEPES Sodium Salt | |
| White | |
| 1 kg | |
| ≥99 % | |
| C8H17N2NaO4S | |
| Poly Bottle | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 | |
| 260.28 | |
| CHEBI:46758 | |
| ≥99% |
Chemical Identifiers
| 75277-39-3 | |
| 260.28 | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| CHEBI:46758 | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 |
| C8H17N2NaO4S | |
| MFCD00036463 | |
| 2724248 | |
| sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate |
Safety and Handling
CAUTION!
Emergency Overview
May cause eye, skin, and respiratory tract irritation. Hygroscopic. Use personal protective equipment. Ensure adequate ventilation. Wash off immediately with plenty of water for at least 15 minutes. Get medical attention immediately if symptoms occur. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Get medical attention immediately if symptoms occur. Do not induce vomiting. Do not induce vomiting. Obtain medical attention.
NFPA
Health:1
Flammability:0
Instability:1
Recommended Storage : RT