missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
HEPES Sodium Salt, Cell Culture Reagent Grade, ≥98.0%, MP Biomedicals™
Supplier: MP Biomedicals Inc 0219455010
Specifications
| HEPES Sodium Salt | |
| White | |
| 10 g | |
| C8H17N2NaO4S | |
| 4-(2-Hydroxyethyl)piperazine-1-ethanesulfonic acid sodium salt, N-(2-Hydroxyethyl)piperazine-N-(2-ethanesulfonic acid) sodium salt | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 | |
| 260.28 | |
| CHEBI:46758 | |
| Cell Culture |
| 75277-39-3 | |
| Powder | |
| ≥98.0% | |
| MFCD00036463 | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate | |
| 2724248 | |
| 260.28 |
Chemical Identifiers
| 75277-39-3 | |
| 260.28 | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| 2724248 | |
| sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate |
| C8H17N2NaO4S | |
| MFCD00036463 | |
| 4-(2-Hydroxyethyl)piperazine-1-ethanesulfonic acid sodium salt, N-(2-Hydroxyethyl)piperazine-N-(2-ethanesulfonic acid) sodium salt | |
| CHEBI:46758 | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 |
Safety and Handling
Recommended Storage : Store at Room Temperature (15 to 30°C).