missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals HEPES sodium salt, 99%
CAS: 75277-39-3 | C8H17N2NaO4S | 260.28 g/mol
Supplier: Thermo Scientific Chemicals 215000010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Biological bufferSpecifications
| (0.1 M aq. soln.), (0.1 M aq. soln.) at 0nm, 0.02 at 280nm, 0.04 at 260nm | |
| 99% | |
| 75277-39-3 | |
| 9.5 to 10.5 (1% aq. soln.) | |
| 1 kg | |
| Authentic | |
| MFCD00036463 | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate | |
| 2724248 | |
| 260.27 |
| HEPES sodium salt | |
| (0.1M aq. soln.) | |
| White | |
| Crystalline Powder | |
| 99% | |
| C8H17N2NaO4S | |
| 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid sodium salt | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 | |
| 260.28 | |
| CHEBI:46758 | |
| ≥98.5% (on anhydrous substance) |
Chemical Identifiers
| 75277-39-3 | |
| 260.28 | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| 2724248 | |
| sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate |
| C8H17N2NaO4S | |
| MFCD00036463 | |
| 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid sodium salt | |
| CHEBI:46758 | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 |
Safety and Handling
EINECSNumber : 278-169-7
TSCA : TSCA
RUO – Research Use Only