missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Guanosine, 99%
CAS: 118-00-3 | C10H13N5O5 | 283.24 g/mol
Supplier: Thermo Scientific Chemicals 411130250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Guanosine | |
| 250°C | |
| 5% max. | |
| 99% | |
| C10H13N5O5 | |
| 25 g | |
| 15, 4601 | |
| -62 | |
| Solubility in water: slightly soluble. Other solubilities: insoluble in ethanol,ethylether,soluble in acetic acid | |
| NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1 | |
| 283.24 | |
| CHEBI:16750 | |
| 99% |
| 118-00-3 | |
| White to Yellow | |
| Authentic | |
| Glass bottle | |
| MFCD00010182 | |
| 26, V,18, 81 | |
| −62.00 (20.00°C c=3,in 0.1 N NaOH) | |
| guanosine, guanine riboside, vernine, guanozin, guanosin, inosine, 2-amino, usaf cb-11, vernine van, l-guanosine, 9-beta-d-ribofuranosylguanine | |
| NYHBQMYGNKIUIF-UUOKFMHZSA-N | |
| 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one | |
| 6802 | |
| 283.23 | |
| Powder |
Chemical Identifiers
| 118-00-3 | |
| 283.24 | |
| NYHBQMYGNKIUIF-UUOKFMHZSA-N | |
| 6802 | |
| NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1 |
| C10H13N5O5 | |
| MFCD00010182 | |
| guanosine, guanine riboside, vernine, guanozin, guanosin, inosine, 2-amino, usaf cb-11, vernine van, l-guanosine, 9-beta-d-ribofuranosylguanine | |
| CHEBI:16750 |
Safety and Handling
GHS H Statement
Toxic if swallowed.
GHS P Statement
Wash face,hands and any exposed skin thoroughly after handling.
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
GHS Signal Word: Danger
EINECSNumber : 204-227-8
RUO – Research Use Only