missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Guanosine, 99%
CAS: 118-00-3 | C10H13N5O5 | 283.24 g/mol
$127.92 - $127.92
Chemical Identifiers
| CAS | 118-00-3 |
|---|---|
| Molecular Formula | C10H13N5O5 |
| Molecular Weight (g/mol) | 283.24 |
| MDL Number | MFCD00010182 |
| InChI Key | NYHBQMYGNKIUIF-UUOKFMHZSA-N |
| Synonym | guanosine, guanine riboside, vernine, guanozin, guanosin, inosine, 2-amino, usaf cb-11, vernine van, l-guanosine, 9-beta-d-ribofuranosylguanine |
| PubChem CID | 6802 |
| ChEBI | CHEBI:16750 |
| SMILES | NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC411130250
|
Thermo Scientific Chemicals
411130250 |
25 g | Glass bottle |
Each for $127.92
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 118-00-3 | |
| 283.24 | |
| NYHBQMYGNKIUIF-UUOKFMHZSA-N | |
| 6802 | |
| NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1 |
| C10H13N5O5 | |
| MFCD00010182 | |
| guanosine, guanine riboside, vernine, guanozin, guanosin, inosine, 2-amino, usaf cb-11, vernine van, l-guanosine, 9-beta-d-ribofuranosylguanine | |
| CHEBI:16750 |
Specifications
| 118-00-3 | |
| White to Yellow | |
| Authentic | |
| Glass bottle | |
| MFCD00010182 | |
| 26, V,18, 81 | |
| −62.00 (20.00°C c=3,in 0.1 N NaOH) | |
| guanosine, guanine riboside, vernine, guanozin, guanosin, inosine, 2-amino, usaf cb-11, vernine van, l-guanosine, 9-beta-d-ribofuranosylguanine | |
| NYHBQMYGNKIUIF-UUOKFMHZSA-N | |
| 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one | |
| 6802 | |
| 283.23 | |
| Powder |
| 250°C | |
| 5% max. | |
| 99% | |
| C10H13N5O5 | |
| 25 g | |
| 15, 4601 | |
| -62 | |
| Solubility in water: slightly soluble. Other solubilities: insoluble in ethanol,ethylether,soluble in acetic acid | |
| NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1 | |
| 283.24 | |
| CHEBI:16750 | |
| 99% | |
| Guanosine |
Safety and Handling
GHS H Statement
Toxic if swallowed.
GHS P Statement
Wash face,hands and any exposed skin thoroughly after handling.
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
GHS Signal Word: Danger
EINECSNumber : 204-227-8
RUO – Research Use Only