Learn More
Gentian Violet, 1% Aqueous, Certified, LabChem™
Supplier: LabChem LC148101
Specifications
| Gentian Violet | |
| 548-62-9 , 7732-18-5 | |
| C25H30ClN3 | |
| Soluble in water | |
| ZXJXZNDDNMQXFV-UHFFFAOYSA-M | |
| [4-[bis[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;chloride | |
| 11057 | |
| 407.99 | |
| Poly Bottle | |
| Purple | |
| Liquid |
| 1% Aqueous | |
| 99,1 | |
| C25H30CIN3 | |
| Passes Test | |
| CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=C(C=C3)N(C)C.[Cl-] | |
| 407.986 | |
| CHEBI:41688 | |
| Certified | |
| Carbon monoxide; Carbon dioxide; Hydrogen chloride; Nitrogen oxides | |
| 500 mL |
Chemical Identifiers
| 548-62-9 | |
| 407.986 | |
| 11057 | |
| [4-[bis[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;chloride |
| C25H30ClN3 | |
| ZXJXZNDDNMQXFV-UHFFFAOYSA-M | |
| CHEBI:41688 | |
| CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=C(C=C3)N(C)C.[Cl-] |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
Suspected of causing cancer.
Harmful to aquatic life with long lasting effects.
GHS P Statement
Obtain special instructions before use.
Do not handle until all safety precautions have been read and understood.
Wear eye protection, protective gloves.
Wash exposed skin thoroughly after handling.
Avoid release to the environment.
f exposed or concerned: Get medical advice/attention.
If in eyes: Rinse cautiously with water for several minutes.
Remove contact lenses, if present and easy to do.
Continue rinsing.
If eye irritation persists: Get medical advice/attention.
Store locked up.
Dispose of contents/container to comply with local, state and federal regulations.
Warning
Recommended Storage : Room Temperature