missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Gallic Acid Standard, 100 ppm C7H6O5, Ricca Chemical
Supplier: Ricca Chemical Company R3223100100A
Specifications
| Gallic Acid Standard, 100ppm | |
| 5995-86-8 , 7732-18-5 | |
| 100.0,0.01 | |
| C7H5O5 | |
| Colorless | |
| 100°C | |
| Miscible with water | |
| Standard | |
| OC1=CC(=CC(O)=C1O)C([O-])=O | |
| 169.11 | |
| 24721416 |
| Natural Poly Bottle | |
| 98.0,0.01 | |
| Liquid | |
| MFCD00149098 | |
| 0.0°C | |
| GC, GC/MS, HPLC, LC/MS, and Other Analytical Instrumentation | |
| Calibration Standard | |
| LNTHITQWFMADLM-UHFFFAOYSA-M | |
| 3,4,5-trihydroxybenzoate | |
| 100 mL | |
| Laboratory |
Chemical Identifiers
| 5995-86-8 | |
| 169.11 | |
| LNTHITQWFMADLM-UHFFFAOYSA-M | |
| 3,4,5-trihydroxybenzoate |
| C7H5O5 | |
| MFCD00149098 | |
| 24721416 | |
| OC1=CC(=CC(O)=C1O)C([O-])=O |