missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
MP Biomedicals Inc Folinic acid, calcium salt, 99.4%, MP Biomedicals™
Supplier: MP Biomedicals Inc 0219150425
Specifications
| Folinic acid, calcium salt | |
| Yellow | |
| C20H22CaN7O7+ | |
| calcium folinate | |
| C1C(N(C2=C(N1)NC(=NC2=O)N)C=O)CNC3=CC=C(C=C3)C(=O)NC(CCC(=O)[O-])C(=O)O.[Ca+2] | |
| 512.516 | |
| 511.5 |
| 1492-18-8 | |
| 0.994 | |
| 25 mg | |
| KVUAALJSMIVURS-ZEDZUCNESA-M | |
| calcium;(4S)-4-[[4-[(2-amino-5-formyl-4-oxo-1,6,7,8-tetrahydropteridin-6-yl)methylamino]benzoyl]amino]-5-hydroxy-5-oxopentanoate | |
| 131675590 | |
| Powder |
Chemical Identifiers
| 1492-18-8 | |
| 512.516 | |
| calcium folinate | |
| calcium;(4S)-4-[[4-[(2-amino-5-formyl-4-oxo-1,6,7,8-tetrahydropteridin-6-yl)methylamino]benzoyl]amino]-5-hydroxy-5-oxopentanoate |
| C20H22CaN7O7+ | |
| KVUAALJSMIVURS-ZEDZUCNESA-M | |
| 131675590 | |
| C1C(N(C2=C(N1)NC(=NC2=O)N)C=O)CNC3=CC=C(C=C3)C(=O)NC(CCC(=O)[O-])C(=O)O.[Ca+2] |