Learn More
Thermo Scientific Chemicals Flufenamic acid, 97%
CAS: 530-78-9 | C14H10F3NO2 | 281.22 g/mol
$66.91 - $66.91
Chemical Identifiers
| CAS | 530-78-9 |
|---|---|
| Molecular Formula | C14H10F3NO2 |
| Molecular Weight (g/mol) | 281.22 |
| MDL Number | MFCD00002422 |
| InChI Key | LPEPZBJOKDYZAD-UHFFFAOYSA-N |
| Synonym | flufenamic acid, fluphenamic acid, nichisedan, achless, arlef, flufacid, fullsafe, lanceat, paraflu, plostene |
| PubChem CID | 3371 |
| ChEBI | CHEBI:42638 |
| IUPAC Name | 2-[3-(trifluoromethyl)anilino]benzoic acid |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC2=CC=CC(=C2)C(F)(F)F |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC165920100
|
Thermo Scientific Chemicals
165920100 |
10 g | Glass bottle |
Each for $66.91
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 530-78-9 | |
| 281.22 | |
| LPEPZBJOKDYZAD-UHFFFAOYSA-N | |
| 3371 | |
| 2-[3-(trifluoromethyl)anilino]benzoic acid |
| C14H10F3NO2 | |
| MFCD00002422 | |
| flufenamic acid, fluphenamic acid, nichisedan, achless, arlef, flufacid, fullsafe, lanceat, paraflu, plostene | |
| CHEBI:42638 | |
| C1=CC=C(C(=C1)C(=O)O)NC2=CC=CC(=C2)C(F)(F)F |
Specifications
| 530-78-9 | |
| Gray-Green to White | |
| 97% | |
| C14H10F3NO2 | |
| MFCD00002422 | |
| 14, III, 905 | |
| flufenamic acid, fluphenamic acid, nichisedan, achless, arlef, flufacid, fullsafe, lanceat, paraflu, plostene | |
| LPEPZBJOKDYZAD-UHFFFAOYSA-N | |
| 2-[3-(trifluoromethyl)anilino]benzoic acid | |
| 3371 | |
| 281.22 | |
| Crystalline Powder and/or Chunks |
| 132°C to 135°C | |
| Authentic | |
| Glass bottle | |
| 2-(CF3C6H4NH)C6H4CO2H | |
| 10 g | |
| 15, 4163 | |
| Solubility in water: 0.0265g/L (37°C). Other solubilities: soluble in ethanol (6.9g/L at 37°C),chloroform,(19g/L at 37°C),dmso,cyclohexane | |
| C1=CC=C(C(=C1)C(=O)O)NC2=CC=CC(=C2)C(F)(F)F | |
| 281.22 | |
| CHEBI:42638 | |
| 97% | |
| Flufenamic acid, 97% |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Causes skin irritation.
Causes serious eye irritation.
Harmful in contact with skin.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
Avoid breathing dust/fume/gas/mist/vapors/spray.
Wash face,hands and any exposed skin thoroug
GHS Signal Word: Danger
EINECSNumber : 208-494-1
RTECSNumber : CB4375000
RUO – Research Use Only