missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Fenticonazole nitrate, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 468792500
Specifications
| Fenticonazole nitrate | |
| Available | |
| Crystalline Powder | |
| 00941391 | |
| 133°C to 137°C | |
| FJNRUWDGCVDXLU-UHFFFAOYNA-N | |
| 1-[2-(2,4-dichlorophenyl)-2-{[4-(phenylsulfanyl)phenyl]methoxy}ethyl]-1H-imidazole; nitric acid | |
| 250 mg |
| Glass Bottle | |
| 73151-29-8 | |
| C24H21Cl2N3O4S | |
| White | |
| 13-4033 | |
| O[N+]([O-])=O.ClC1=CC=C(C(CN2C=CN=C2)OCC2=CC=C(SC3=CC=CC=C3)C=C2)C(Cl)=C1 | |
| 518.41 |
Chemical Identifiers
| 73151-29-8 | |
| 518.41 | |
| FJNRUWDGCVDXLU-UHFFFAOYNA-N | |
| O[N+]([O-])=O.ClC1=CC=C(C(CN2C=CN=C2)OCC2=CC=C(SC3=CC=CC=C3)C=C2)C(Cl)=C1 |
| C24H21Cl2N3O4S | |
| 00941391 | |
| 1-[2-(2,4-dichlorophenyl)-2-{[4-(phenylsulfanyl)phenyl]methoxy}ethyl]-1H-imidazole; nitric acid |
Safety and Handling
Health hazard
Exclamation mark
EINECSNumber : 277-302-6
RTECSNumber : NI4780000
Recommended Storage : Normal conditions