Learn More
Ethylenediaminetetraacetic acid, iron(III) monosodium salt
CAS: 15708-41-5 | C10H12FeN2NaO8 | 367.047 g/mol
Supplier: Thermo Scientific Chemicals 08899536
Description
Ethylenediaminetetraacetic acid, iron(III) monosodium salt is used to eliminate enzyme inhibition by traces of heavy metals and to inhibit enzymes that require divalent cations as cofactors.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Ethylenediaminetetraacetic acid, iron (III) monosodium salt | |
| Odorless | |
| MFCD00078215 | |
| sodium feredetate, edta ferric sodium salt, calmosine, sodium ironedetate, edta iron iii sodium salt, ferisan, sytron, sequestrene nafe, sodium iron edta, ferric sodium edta | |
| MKWYFZFMAMBPQK-UHFFFAOYSA-J | |
| sodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+) | |
| 27461 | |
| 367.05 |
| 15708-41-5 | |
| C10H12FeN2NaO8 | |
| 500 g | |
| Soluble in water. | |
| C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Fe+3] | |
| 367.047 | |
| CHEBI:78292 | |
| Powder |
Chemical Identifiers
| 15708-41-5 | |
| 367.047 | |
| MKWYFZFMAMBPQK-UHFFFAOYSA-J | |
| 27461 | |
| sodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+) |
| C10H12FeN2NaO8 | |
| MFCD00078215 | |
| sodium feredetate, edta ferric sodium salt, calmosine, sodium ironedetate, edta iron iii sodium salt, ferisan, sytron, sequestrene nafe, sodium iron edta, ferric sodium edta | |
| CHEBI:78292 | |
| C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Fe+3] |
Safety and Handling
EINECSNumber : 239-802-2
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only