missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ethyl 4-Nitrophenylacetate 98.0+%, TCI America™
Supplier: TCI America N02285G
Specifications
| Ethyl 4-Nitrophenylacetate | |
| 64°C | |
| 196°C | |
| MFCD00017046 | |
| ethyl 4-nitrophenylacetate, ethyl 2-4-nitrophenyl acetate, ethyl p-nitrophenylacetate, ethyl 4-nitrobenzeneacetate, ethyl 4-nitrophenyl acetate, 4-nitrophenylacetic acid ethyl ester, benzeneacetic acid, 4-nitro-, ethyl ester, ethyl-4-nitrophenylacetate, acetic acid, p-nitrophenyl-, ethyl ester, 4-nitro-phenyl-acetic acid ethyl ester | |
| CCOC(=O)CC1=CC=C(C=C1)[N+]([O-])=O | |
| 209.20 | |
| 209.20 | |
| Crystalline Powder |
| 5445-26-1 | |
| White-Yellow | |
| C10H11NO4 | |
| 5 g | |
| DWDRNKYLWMKWTH-UHFFFAOYSA-N | |
| ethyl 2-(4-nitrophenyl)acetate | |
| 79517 | |
| ≥98.0% (GC) |
Chemical Identifiers
| 5445-26-1 | |
| 209.20 | |
| DWDRNKYLWMKWTH-UHFFFAOYSA-N | |
| 79517 | |
| CCOC(=O)CC1=CC=C(C=C1)[N+]([O-])=O |
| C10H11NO4 | |
| MFCD00017046 | |
| ethyl 4-nitrophenylacetate, ethyl 2-4-nitrophenyl acetate, ethyl p-nitrophenylacetate, ethyl 4-nitrobenzeneacetate, ethyl 4-nitrophenyl acetate, 4-nitrophenylacetic acid ethyl ester, benzeneacetic acid, 4-nitro-, ethyl ester, ethyl-4-nitrophenylacetate, acetic acid, p-nitrophenyl-, ethyl ester, 4-nitro-phenyl-acetic acid ethyl ester | |
| ethyl 2-(4-nitrophenyl)acetate |
Safety and Handling
TSCA : Yes