missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Erythrosin B, pure, certified, ACROS Organics™
$67.31 - $243.55
Chemical Identifiers
| CAS | 16423-68-0 |
|---|---|
| Molecular Formula | C20H6I4Na2O5 |
| Molecular Weight (g/mol) | 879.86 |
| MDL Number | MFCD00144257 |
| InChI Key | RAGZEDHHTPQLAI-UHFFFAOYSA-L |
| Synonym | Acid Red 51 |
| PubChem CID | 12961638 |
| IUPAC Name | disodium;2',4',5',7'-tetraiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=CC(=C(C(=C4OC5=C(C(=C(C=C35)I)[O-])I)I)[O-])I.[Na+].[Na+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC409450250 SDS |
Acros Organics
409450250 |
25g | Glass bottle |
Each for $67.31
|
|
AC409451000 SDS |
Acros Organics
AC409451000 |
100g | Glass bottle |
Each for $243.55
|
|
Description
IndicatorChemical Identifiers
| 16423-68-0 | |
| 879.86 | |
| RAGZEDHHTPQLAI-UHFFFAOYSA-L | |
| 12961638 | |
| C1=CC=C2C(=C1)C(=O)OC23C4=CC(=C(C(=C4OC5=C(C(=C(C=C35)I)[O-])I)I)[O-])I.[Na+].[Na+] |
| C20H6I4Na2O5 | |
| MFCD00144257 | |
| Acid Red 51 | |
| disodium;2',4',5',7'-tetraiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate |
Specifications
| 16423-68-0 | |
| 80% min. | |
| MFCD00144257 | |
| 15, 3749 | |
| RAGZEDHHTPQLAI-UHFFFAOYSA-L | |
| C1=CC=C2C(=C1)C(=O)OC23C4=CC(=C(C(=C4OC5=C(C(=C(C=C35)I)[O-])I)I)[O-])I.[Na+].[Na+] | |
| 879.86 | |
| 12961638 | |
| Fine Powder | |
| Glass bottle | |
| 25g |
| 1.15 to 1.55 | |
| C20H6I4Na2O5 | |
| 19, II, 258 | |
| Acid Red 51 | |
| Authentic | |
| disodium;2',4',5',7'-tetraiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate | |
| 524 to 527nm | |
| 879.85 | |
| Pure | |
| Brown to Red | |
| Erythrosin B, Pure |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Warning