missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Erythrosin B, pure, certified
CAS: 16423-68-0 | C20H6I4Na2O5 | 879.86 g/mol
$112.20 - $398.91
Chemical Identifiers
| CAS | 16423-68-0 |
|---|---|
| Molecular Formula | C20H6I4Na2O5 |
| Molecular Weight (g/mol) | 879.86 |
| MDL Number | MFCD00144257 |
| InChI Key | IINNWAYUJNWZRM-UHFFFAOYSA-L |
| Synonym | Acid Red 51, C.I. 45430 |
| PubChem CID | 12961638 |
| SMILES | [Na+].[Na+].[O-]C(=O)C1=C(C=CC=C1)C1=C2C=C(I)C(=O)C(I)=C2OC2=C(I)C([O-])=C(I)C=C12 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Qty | ||||
|
AC409450250
|
Thermo Scientific Chemicals
409450250 |
25 g | Glass bottle |
Each for $112.20
|
|
||||
|
AC409451000
|
Thermo Scientific Chemicals
409451000 |
100 g | Glass bottle |
Each for $398.91
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorChemical Identifiers
| 16423-68-0 | |
| 879.86 | |
| IINNWAYUJNWZRM-UHFFFAOYSA-L | |
| 12961638 |
| C20H6I4Na2O5 | |
| MFCD00144257 | |
| Acid Red 51, C.I. 45430 | |
| [Na+].[Na+].[O-]C(=O)C1=C(C=CC=C1)C1=C2C=C(I)C(=O)C(I)=C2OC2=C(I)C([O-])=C(I)C=C12 |
Specifications
| 16423-68-0 | |
| 80% min. | |
| MFCD00144257 | |
| 15, 3749 | |
| IINNWAYUJNWZRM-UHFFFAOYSA-L | |
| [Na+].[Na+].[O-]C(=O)C1=C(C=CC=C1)C1=C2C=C(I)C(=O)C(I)=C2OC2=C(I)C([O-])=C(I)C=C12 | |
| 879.86 | |
| 524 to 527nm | |
| Pure | |
| Brown to Red | |
| Fine Powder |
| 1.15 to 1.55 | |
| C20H6I4Na2O5 | |
| 19, II, 258 | |
| Acid Red 51, C.I. 45430 | |
| Authentic | |
| disodium;2',4',5',7'-tetraiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate | |
| 12961638 | |
| 879.85 | |
| Glass bottle | |
| 25 g | |
| Erythrosin B, Pure |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Warning
RUO – Research Use Only