missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Disodium Bathocuproine, For Copper, Certified, 0.1%, LabChem™
Supplier: LabChem LC136851
Specifications
| Disodium Bathocuproine | |
| For Copper | |
| 99.9,0.1 | |
| C26H18N2Na2O6S2 | |
| disodium bathocuproinedisulfonate, sodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, disodium bathocuproinedisulfonate, bathocuproinedisulfonic acid sodium salt, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate disodium salt, dipotassium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate | |
| RNGKZLRAVYPLJC-UHFFFAOYSA-L | |
| disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate | |
| 15678335 | |
| 0.1% | |
| Passes Test | |
| Passes Test | |
| 500 mL |
| Yellow | |
| 52698-84-7,7732-18-5 | |
| C26H18N2Na2O6S2 | |
| MFCD00149974 | |
| Soluble in water | |
| [Na+].[Na+].CC1=NC2=C(C=CC3=C2N=C(C)C(=C3C2=CC=CC=C2)S([O-])(=O)=O)C(C2=CC=CC=C2)=C1S([O-])(=O)=O | |
| 564.54 | |
| 564.54 | |
| Certified | |
| Poly Bottle | |
| Nitrogen oxides; Carbon monoxide; Carbon dioxide | |
| Liquid |
Chemical Identifiers
| 52698-84-7 | |
| 564.54 | |
| RNGKZLRAVYPLJC-UHFFFAOYSA-L | |
| 15678335 | |
| [Na+].[Na+].CC1=NC2=C(C=CC3=C2N=C(C)C(=C3C2=CC=CC=C2)S([O-])(=O)=O)C(C2=CC=CC=C2)=C1S([O-])(=O)=O |
| C26H18N2Na2O6S2 | |
| MFCD00149974 | |
| disodium bathocuproinedisulfonate, sodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, disodium bathocuproinedisulfonate, bathocuproinedisulfonic acid sodium salt, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate disodium salt, dipotassium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate | |
| disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature