missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Diphenylmethane, 99%
CAS: 101-81-5 | C13H12 | 168.24 g/mol
$192.92 - $192.92
Chemical Identifiers
| CAS | 101-81-5 |
|---|---|
| Molecular Formula | C13H12 |
| Molecular Weight (g/mol) | 168.24 |
| MDL Number | MFCD00004781 |
| InChI Key | CZZYITDELCSZES-UHFFFAOYSA-N |
| Synonym | diphenylmethane, ditan, ditane, benzene, 1,1'-methylenebis, diphenyl methane, benzene, benzyl, methane, diphenyl, 1,1'-dimethylenebis benzene, benzene, phenylmethyl, methylenedibenzene |
| PubChem CID | 7580 |
| ChEBI | CHEBI:38884 |
| IUPAC Name | benzylbenzene |
| SMILES | C(C1=CC=CC=C1)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC117350010
|
Thermo Scientific Chemicals
117350010 |
1 kg | Glass bottle |
Each for $192.92
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 101-81-5 | |
| 168.24 | |
| CZZYITDELCSZES-UHFFFAOYSA-N | |
| 7580 | |
| benzylbenzene |
| C13H12 | |
| MFCD00004781 | |
| diphenylmethane, ditan, ditane, benzene, 1,1'-methylenebis, diphenyl methane, benzene, benzyl, methane, diphenyl, 1,1'-dimethylenebis benzene, benzene, phenylmethyl, methylenedibenzene | |
| CHEBI:38884 | |
| C(C1=CC=CC=C1)C1=CC=CC=C1 |
Specifications
| 101-81-5 | |
| Colorless to Yellow | |
| 265.0°C | |
| Authentic | |
| Glass bottle | |
| 1.5760 to 1.5780 | |
| MFCD00004781 | |
| 05, II, 498 | |
| 15, 3362 | |
| Solubility in water: practically insoluble. Other solubilities: insoluble in liquid ammonia, freely soluble in alcohol, ether, chloroform,, hexane and benzene | |
| C(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 168.24 | |
| CHEBI:38884 | |
| 99% | |
| Diphenylmethane, 99% |
| 24.5°C to 25.0°C | |
| 1.0000g/mL | |
| 127°C | |
| 98.5% min. (GC) | |
| C13H12 | |
| (C6H5)2CH2 | |
| 1 kg | |
| 1 | |
| diphenylmethane, ditan, ditane, benzene, 1,1'-methylenebis, diphenyl methane, benzene, benzyl, methane, diphenyl, 1,1'-dimethylenebis benzene, benzene, phenylmethyl, methylenedibenzene | |
| CZZYITDELCSZES-UHFFFAOYSA-N | |
| benzylbenzene | |
| 7580 | |
| 168.24 | |
| Low Melting Solid |
Safety and Handling
GHS Signal Word: Warning
EINECSNumber : 202-978-6
RTECSNumber : DA4976500
TSCA : TSCA
RUO – Research Use Only