Learn More
Diphenyliodonium chloride, 97%
CAS: 1483-72-3 | C12H10ClI | 316.57 g/mol
Supplier: Thermo Scientific Chemicals 117330100
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Diphenyliodonium chloride | |
| 227°C to 228°C | |
| Authentic | |
| Glass bottle | |
| (C6H5)2ICl | |
| 10 g | |
| diphenyliodonium chloride, diphenyliodanium chloride, iodonium, diphenyl-, chloride, diphenyliodoniumchloride, c12h10i.cl, iodonium, diphenyl-, chloride 1:1, acmc-1bxx9 | |
| RSJLWBUYLGJOBD-UHFFFAOYSA-M | |
| diphenyliodanium;chloride | |
| 73870 | |
| 97% |
| 1483-72-3 | |
| Cream-Yellow to White | |
| 97% | |
| C12H10ClI | |
| MFCD00011909 | |
| 01,341; 02,178 | |
| Solubility in water: soluble. Other solubilities: soluble in methanol | |
| [Cl-].[I+](C1=CC=CC=C1)C1=CC=CC=C1 | |
| 316.57 | |
| 316.57 | |
| Powder |
Chemical Identifiers
| 1483-72-3 | |
| 316.57 | |
| RSJLWBUYLGJOBD-UHFFFAOYSA-M | |
| 73870 | |
| [Cl-].[I+](C1=CC=CC=C1)C1=CC=CC=C1 |
| C12H10ClI | |
| MFCD00011909 | |
| diphenyliodonium chloride, diphenyliodanium chloride, iodonium, diphenyl-, chloride, diphenyliodoniumchloride, c12h10i.cl, iodonium, diphenyl-, chloride 1:1, acmc-1bxx9 | |
| diphenyliodanium;chloride |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wear protective gloves/protective clothing/eye protection/face protection.
If skin irritation occurs: Get medical advice/attention.
If eye irritatio
GHS Signal Word: Danger
EINECSNumber : 216-049-8
RUO – Research Use Only