missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Diethylene Glycol Bis(3-aminopropyl) Ether 98.0+%, TCI America™
Supplier: TCI America D1571500ML
Specifications
| Diethylene Glycol Bis(3-aminopropyl) Ether | |
| Yellow | |
| C10H26N2O3 | |
| 500 mL | |
| 4,7,10-trioxa-1,13-tridecanediamine, 3,3'-oxybis ethane-2,1-diyl bis oxy bis propan-1-amine, diethylene glycol bis 3-aminopropyl ether, unii-95w232h4rt, 3,3'-oxybis ethyleneoxy bis propylamine, di 3-aminopropyl ether of diethylene glycol, diethylene glycol, di 3-aminopropyl ether, 1-propanamine, 3,3'-oxybis 2,1-ethanediyloxy bis, 3,3'-oxybis 2,1-ethanediyloxy bis-1-propanamine | |
| [NH3+]CCCOCCOCCOCCC[NH3+] | |
| 222.33 | |
| 220.31 | |
| Liquid |
| 4246-51-9 | |
| 151°C | |
| MFCD00059850 | |
| 2735 | |
| JCEZOHLWDIONSP-UHFFFAOYSA-P | |
| 3-{2-[2-(3-azaniumylpropoxy)ethoxy]ethoxy}propan-1-aminium | |
| 20239 | |
| ≥98.0% (GC,T) |
Chemical Identifiers
| 4246-51-9 | |
| 222.33 | |
| JCEZOHLWDIONSP-UHFFFAOYSA-P | |
| 20239 | |
| [NH3+]CCCOCCOCCOCCC[NH3+] |
| C10H26N2O3 | |
| MFCD00059850 | |
| 4,7,10-trioxa-1,13-tridecanediamine, 3,3'-oxybis ethane-2,1-diyl bis oxy bis propan-1-amine, diethylene glycol bis 3-aminopropyl ether, unii-95w232h4rt, 3,3'-oxybis ethyleneoxy bis propylamine, di 3-aminopropyl ether of diethylene glycol, diethylene glycol, di 3-aminopropyl ether, 1-propanamine, 3,3'-oxybis 2,1-ethanediyloxy bis, 3,3'-oxybis 2,1-ethanediyloxy bis-1-propanamine | |
| 3-{2-[2-(3-azaniumylpropoxy)ethoxy]ethoxy}propan-1-aminium |
Safety and Handling
EINECSNumber : (7)-1234
RTECSNumber : ID6475000
TSCA : Yes