missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Diethylene Glycol Bis(3-aminopropyl) Ether 98.0+%, TCI America™
$54.06 - $192.00
Chemical Identifiers
| CAS | 4246-51-9 |
|---|---|
| Molecular Formula | C10H26N2O3 |
| Molecular Weight (g/mol) | 222.33 |
| MDL Number | MFCD00059850 |
| InChI Key | JCEZOHLWDIONSP-UHFFFAOYSA-P |
| Synonym | 4,7,10-trioxa-1,13-tridecanediamine, 3,3'-oxybis ethane-2,1-diyl bis oxy bis propan-1-amine, diethylene glycol bis 3-aminopropyl ether, unii-95w232h4rt, 3,3'-oxybis ethyleneoxy bis propylamine, di 3-aminopropyl ether of diethylene glycol, diethylene glycol, di 3-aminopropyl ether, 1-propanamine, 3,3'-oxybis 2,1-ethanediyloxy bis, 3,3'-oxybis 2,1-ethanediyloxy bis-1-propanamine |
| PubChem CID | 20239 |
| IUPAC Name | 3-{2-[2-(3-azaniumylpropoxy)ethoxy]ethoxy}propan-1-aminium |
| SMILES | [NH3+]CCCOCCOCCOCCC[NH3+] |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
D157125ML
|
TCI America
D157125ML |
25 mL |
Each for $54.06
|
|
|||||
|
D1571100ML
|
TCI America
D1571100ML |
100 mL |
Each for $104.38
|
|
|||||
|
D1571500ML
|
TCI America
D1571500ML |
500 mL |
Each for $192.00
|
|
|||||
Chemical Identifiers
| 4246-51-9 | |
| 222.33 | |
| JCEZOHLWDIONSP-UHFFFAOYSA-P | |
| 20239 | |
| [NH3+]CCCOCCOCCOCCC[NH3+] |
| C10H26N2O3 | |
| MFCD00059850 | |
| 4,7,10-trioxa-1,13-tridecanediamine, 3,3'-oxybis ethane-2,1-diyl bis oxy bis propan-1-amine, diethylene glycol bis 3-aminopropyl ether, unii-95w232h4rt, 3,3'-oxybis ethyleneoxy bis propylamine, di 3-aminopropyl ether of diethylene glycol, diethylene glycol, di 3-aminopropyl ether, 1-propanamine, 3,3'-oxybis 2,1-ethanediyloxy bis, 3,3'-oxybis 2,1-ethanediyloxy bis-1-propanamine | |
| 3-{2-[2-(3-azaniumylpropoxy)ethoxy]ethoxy}propan-1-aminium |
Specifications
| 4246-51-9 | |
| 151°C | |
| MFCD00059850 | |
| 2735 | |
| JCEZOHLWDIONSP-UHFFFAOYSA-P | |
| 3-{2-[2-(3-azaniumylpropoxy)ethoxy]ethoxy}propan-1-aminium | |
| 20239 | |
| ≥98.0% (GC,T) | |
| Diethylene Glycol Bis(3-aminopropyl) Ether |
| Yellow | |
| C10H26N2O3 | |
| 25 mL | |
| 4,7,10-trioxa-1,13-tridecanediamine, 3,3'-oxybis ethane-2,1-diyl bis oxy bis propan-1-amine, diethylene glycol bis 3-aminopropyl ether, unii-95w232h4rt, 3,3'-oxybis ethyleneoxy bis propylamine, di 3-aminopropyl ether of diethylene glycol, diethylene glycol, di 3-aminopropyl ether, 1-propanamine, 3,3'-oxybis 2,1-ethanediyloxy bis, 3,3'-oxybis 2,1-ethanediyloxy bis-1-propanamine | |
| [NH3+]CCCOCCOCCOCCC[NH3+] | |
| 222.33 | |
| 220.31 | |
| Liquid |
Safety and Handling
EINECSNumber : (7)-1234
RTECSNumber : ID6475000
TSCA : Yes