missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Diethyl terephthalate, 98%
CAS: 636-09-9 | C12H14O4 | 222.24 g/mol
$203.50 - $603.97
Chemical Identifiers
| CAS | 636-09-9 |
|---|---|
| Molecular Formula | C12H14O4 |
| Molecular Weight (g/mol) | 222.24 |
| MDL Number | MFCD00039891 |
| InChI Key | ONIHPYYWNBVMID-UHFFFAOYSA-N |
| Synonym | diethyl terephthalate, p-diethyl phthalate, diethylterephthalate, terephthalic acid, diethyl ester, 1,4-benzenedicarboxylic acid, diethyl ester, diethyl p-phthalate, terephthalic acid diethyl ester, unii-n97x85l3cd, 1,4-diethyl benzene-1,4-dicarboxylate, 1,4-benzenedicarboxylic acid, 1,4-diethyl ester |
| PubChem CID | 12483 |
| IUPAC Name | diethyl benzene-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C(=O)OCC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC407450250
|
Thermo Scientific Chemicals
407450250 |
25 g | Glass bottle |
Each for $203.50
|
|
||||
|
AC407451000
|
Thermo Scientific Chemicals
407451000 |
100 g | Glass bottle |
Each for $603.97
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 636-09-9 | |
| 222.24 | |
| ONIHPYYWNBVMID-UHFFFAOYSA-N | |
| 12483 | |
| CCOC(=O)C1=CC=C(C=C1)C(=O)OCC |
| C12H14O4 | |
| MFCD00039891 | |
| diethyl terephthalate, p-diethyl phthalate, diethylterephthalate, terephthalic acid, diethyl ester, 1,4-benzenedicarboxylic acid, diethyl ester, diethyl p-phthalate, terephthalic acid diethyl ester, unii-n97x85l3cd, 1,4-diethyl benzene-1,4-dicarboxylate, 1,4-benzenedicarboxylic acid, 1,4-diethyl ester | |
| diethyl benzene-1,4-dicarboxylate |
Specifications
| 636-09-9 | |
| White | |
| 302.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00039891 | |
| 1.11 | |
| Solubility in water: insoluble. Other solubilities: soluble in methanol,ether,ethanol | |
| CCOC(=O)C1=CC=C(C=C1)C(=O)OCC | |
| 222.24 | |
| 222.24 | |
| Crystalline Low Melting Solid |
| 42.0°C to 45.0°C | |
| 1.1100g/mL | |
| 117°C | |
| 97.5% min. (GC) | |
| C12H14O4 | |
| 25 g | |
| diethyl terephthalate, p-diethyl phthalate, diethylterephthalate, terephthalic acid, diethyl ester, 1,4-benzenedicarboxylic acid, diethyl ester, diethyl p-phthalate, terephthalic acid diethyl ester, unii-n97x85l3cd, 1,4-diethyl benzene-1,4-dicarboxylate, 1,4-benzenedicarboxylic acid, 1,4-diethyl ester | |
| ONIHPYYWNBVMID-UHFFFAOYSA-N | |
| diethyl benzene-1,4-dicarboxylate | |
| 12483 | |
| 98% | |
| Diethyl terephthalate, 98% |
Safety and Handling
EINECSNumber : 211-249-1
RTECSNumber : WZ1223400
TSCA : TSCA
RUO – Research Use Only