Learn More
Dibenzylamine, 98%
CAS: 103-49-1 | C14H15N | 197.28 g/mol
Supplier: Thermo Scientific Chemicals 112612500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Dibenzylamine | |
| 103-49-1 | |
| Colorless to Yellow | |
| 300°C | |
| Authentic | |
| Glass bottle | |
| 1.5740 to 1.576 | |
| MFCD00004770 | |
| 12, 1035 | |
| 15, 3016 | |
| Solubility in water: 0.05g/L (20°C). Other solubilities: soluble in alcohol,ether,toluene and chloroform,reacts with organic and inorganic acids | |
| C(NCC1=CC=CC=C1)C1=CC=CC=C1 | |
| 197.28 | |
| 197.28 | |
| Liquid |
| 98% | |
| -26°C | |
| 1.0200g/mL | |
| 138°C | |
| 97.5% min. (GC) | |
| C14H15N | |
| (C6H5CH2)2NH | |
| 250 mL | |
| 1.02 | |
| dibenzylamine, benzenemethanamine, n-phenylmethyl, n-benzylbenzylamine, bibenzylamine, dibenzyl-amine, dibenzyl amine, bisbenzylamine, n,n-dibenzylamine, n-benzylaminomethyl benzene, unii-3g0yfx01c6 | |
| BWLUMTFWVZZZND-UHFFFAOYSA-N | |
| N-benzyl-1-phenylmethanamine | |
| 7656 | |
| 98% |
Chemical Identifiers
| 103-49-1 | |
| 197.28 | |
| BWLUMTFWVZZZND-UHFFFAOYSA-N | |
| 7656 |
| C14H15N | |
| MFCD00004770 | |
| dibenzylamine, benzenemethanamine, n-phenylmethyl, n-benzylbenzylamine, bibenzylamine, dibenzyl-amine, dibenzyl amine, bisbenzylamine, n,n-dibenzylamine, n-benzylaminomethyl benzene, unii-3g0yfx01c6 | |
| C(NCC1=CC=CC=C1)C1=CC=CC=C1 |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes severe skin burns and eye damage.
Very toxic to aquatic life with long lasting effects.
GHS P Statement
Avoid release to the environment.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/f
GHS Signal Word: Danger
EINECSNumber : 203-117-7
TSCA : TSCA
RUO – Research Use Only