Learn More
Diallyl phthalate, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 276620010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Diallyl phthalate | |
| 1.1200g/mL | |
| 166°C | |
| 97.5% min. (GC) | |
| C14H14O4 | |
| MFCD00008646 | |
| 3082 | |
| 1.12 | |
| Solubility in water: 148mg/l (20°C) | |
| C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C | |
| 246.26 | |
| 13 mPa.s (20°C) | |
| 98% |
| 131-17-9 | |
| 300.0°C | |
| Authentic | |
| Glass bottle | |
| 1.5180 to 1.5200 | |
| 1L | |
| 09, 4120 | |
| diallyl phthalate, allyl phthalate, diallylphthalate, dapon r, phthalic acid diallyl ester, dapon 35, phthalic acid, diallyl ester, o-phthalic acid, diallyl ester, 1,2-benzenedicarboxylic acid, di-2-propenyl ester, unii-f79l0ul6st | |
| QUDWYFHPNIMBFC-UHFFFAOYSA-N | |
| bis(prop-2-enyl) benzene-1,2-dicarboxylate | |
| 8560 | |
| 246.26 |
Chemical Identifiers
| 131-17-9 | |
| 246.26 | |
| QUDWYFHPNIMBFC-UHFFFAOYSA-N | |
| 8560 | |
| C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C |
| C14H14O4 | |
| MFCD00008646 | |
| diallyl phthalate, allyl phthalate, diallylphthalate, dapon r, phthalic acid diallyl ester, dapon 35, phthalic acid, diallyl ester, o-phthalic acid, diallyl ester, 1,2-benzenedicarboxylic acid, di-2-propenyl ester, unii-f79l0ul6st | |
| bis(prop-2-enyl) benzene-1,2-dicarboxylate |
Safety and Handling
GHS H Statement
Very toxic to aquatic life with long lasting effects.
Harmful if swallowed.
Harmful if inhaled.
May cause an allergic skin reaction.
Suspected of causing genetic defects.
May cause damage to organs thr
GHS P Statement
Avoid release to the environment.
Do not get in eyes,on skin,or on clothing.
Call a POISON CENTRE or doctor/physician.
GHS Signal Word: Warning
EINECSNumber : 205-016-3
RUO â Research Use Only