missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Denatonium Benzoate, Anhydrous, Granular, NF, 99.5-101%, Spectrum™ Chemical
DE101, 3734-33-6, C28H34N2O3
Supplier: Spectrum Chemical Mfg Cor DE1011KGBL
Description
Spectrum™ Chemical Denatonium Benzoate, Anhydrous, Granular, NF is used as a denaturant and masking agent. All Spectrum Chemical NF grade products are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Specifications
| 3734-33-6 | |
| 0.1% | |
| 163-170°C | |
| C28H34N2O3 | |
| 1 kg | |
| [O-]C(=O)C1=CC=CC=C1.CC[N+](CC)(CC(=O)NC1=C(C)C=CC=C1C)CC1=CC=CC=C1 | |
| 446.59 | |
| NF |
| 100% | |
| 1% | |
| Amber Glass Bottle | |
| MFCD00031578 | |
| VWTINHYPRWEBQY-UHFFFAOYSA-N | |
| benzyl({[(2,6-dimethylphenyl)carbamoyl]methyl})diethylazanium benzoate | |
| 99.5 to 101% |
Chemical Identifiers
| 3734-33-6 | |
| 446.59 | |
| VWTINHYPRWEBQY-UHFFFAOYSA-N | |
| [O-]C(=O)C1=CC=CC=C1.CC[N+](CC)(CC(=O)NC1=C(C)C=CC=C1C)CC1=CC=CC=C1 |
| C28H34N2O3 | |
| MFCD00031578 | |
| benzyl({[(2,6-dimethylphenyl)carbamoyl]methyl})diethylazanium benzoate |