missing translation for 'onlineSavingsMsg'
Learn More
Learn More
D and C Green No. 5, Spectrum™ Chemical
D1119, 4403-90-1, C28H20N2O8S2Na2
Supplier: Spectrum Chemical Mfg Cor D1119100GM
Description
Spectrum™ Chemical D and C Green No. 5Specifications
| D and C Green No. 5 | |
| 100% | |
| FPAYXBWMYIMERV-UHFFFAOYSA-L | |
| disodium 5-methyl-2-({4-[(4-methyl-2-sulfonatophenyl)amino]-9,10-dioxo-9,10-dihydroanthracen-1-yl}amino)benzene-1-sulfonate | |
| Reagent | |
| Blue/Green |
| 4403-90-1 | |
| C28H20N2Na2O8S2 | |
| [Na+].[Na+].CC1=CC=C(NC2=CC=C(NC3=CC=C(C)C=C3S([O-])(=O)=O)C3=C2C(=O)C2=CC=CC=C2C3=O)C(=C1)S([O-])(=O)=O | |
| 622.57 | |
| Amber Glass Bottle | |
| 100 g |
Chemical Identifiers
| 4403-90-1 | |
| 622.57 | |
| disodium 5-methyl-2-({4-[(4-methyl-2-sulfonatophenyl)amino]-9,10-dioxo-9,10-dihydroanthracen-1-yl}amino)benzene-1-sulfonate |
| C28H20N2Na2O8S2 | |
| FPAYXBWMYIMERV-UHFFFAOYSA-L | |
| [Na+].[Na+].CC1=CC=C(NC2=CC=C(NC3=CC=C(C)C=C3S([O-])(=O)=O)C3=C2C(=O)C2=CC=CC=C2C3=O)C(=C1)S([O-])(=O)=O |