missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
COD Standard, 300ppm (1mL = 0.3mg COD) (Potassium Acid Phthalate in Water), Certified, 0.300mg/mL ±0.003, LabChem™
Supplier: LabChem LC132401
Specifications
| COD Standard | |
| 300ppm (1mL = 0.3mg COD) (Potassium Acid Phthalate in Water) | |
| Poly Bottle | |
| 99.67,0.03,0.3 | |
| as COD | |
| KHC8H4O4 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] | |
| 204.222 | |
| 204.22 | |
| Passes Test | |
| Liquid |
| 0.300mg/mL ±0.003 | |
| 877-24-7,7664-38-2,7732-18-5 | |
| 500 mL | |
| Colorless | |
| C8H5KO4 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate | |
| 23676735 | |
| Certified | |
| Soluble in water |
Chemical Identifiers
| 877-24-7 | |
| 204.222 | |
| 23676735 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| C8H5KO4 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature