missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Citric Acid Monohydrate, For Analysis, ACS, EMSURE™, MilliporeSigma™
Supplier: Technidata 1002441000
Specifications
| 1.85 | |
| 5949-29-1 | |
| C6H10O8 | |
| YASYEJJMZJALEJ-UHFFFAOYSA-N | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate | |
| 22230 | |
| 210.14 | |
| ACS/ISO/Reagent Ph. Eur. | |
| Plastic Bottle | |
| 0.1 hPa at 20°C |
| 135°C to 152°C | |
| White | |
| citric acid monohydrate, citric acid hydrate, 2-hydroxypropane-1,2,3-tricarboxylic acid hydrate, citric acid, monohydrate, unii-2968phw8qp, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate, citrate, acidum citricum monohydricum, citric acid monohydrate usp | |
| C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O | |
| 210.138 | |
| CHEBI:31404 | |
| 99.5 to 100.5 % | |
| 1 kg | |
| Solid |
Chemical Identifiers
| 5949-29-1 | |
| 210.138 | |
| citric acid monohydrate, citric acid hydrate, 2-hydroxypropane-1,2,3-tricarboxylic acid hydrate, citric acid, monohydrate, unii-2968phw8qp, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate, citrate, acidum citricum monohydricum, citric acid monohydrate uspShow More | |
| CHEBI:31404 | |
| C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O |
| C6H10O8 | |
| YASYEJJMZJALEJ-UHFFFAOYSA-N | |
| 22230 | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate |
Safety and Handling
EINECSNumber : 201-069-1