missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Choline Dihydrogen Citrate, 98%, Spectrum™ Chemical
Supplier: Spectrum Chemical Mfg Cor C122925KG
Specifications
| 77-91-8 | |
| Poly Pail | |
| 2.5 kg | |
| C[N+](C)(C)CCO.OC(=O)CC(O)(CC(O)=O)C([O-])=O | |
| 295.29 | |
| Reagent |
| 1 | |
| C11H21NO8 | |
| WRPUOFKIGGWQIJ-UHFFFAOYSA-M | |
| (2-hydroxyethyl)trimethylazanium 3-carboxy-2-(carboxymethyl)-2-hydroxypropanoate | |
| 0.98 |
Chemical Identifiers
| 77-91-8 | |
| 295.29 | |
| (2-hydroxyethyl)trimethylazanium 3-carboxy-2-(carboxymethyl)-2-hydroxypropanoate |
| C11H21NO8 | |
| WRPUOFKIGGWQIJ-UHFFFAOYSA-M | |
| C[N+](C)(C)CCO.OC(=O)CC(O)(CC(O)=O)C([O-])=O |
CAUTION: For manufacturing or laboratory use only. Read and understand the label and Safety Data Sheet (SDS) prior to use.