Learn More
Chloramphenicol (Crystalline Powder), Fisher BioReagents
For selecting transformed cells containing chloramphenicol resistance genes
Supplier: Fisher BioReagents FLBP904100
Description
Used as a selection agent for transformed cells containing chloramphenicol resistance genes. Mode of Action: Inhibits translation on the 50S ribosomal subunit at the peptidyltransferase step (elongation inhibition).Specifications
| Chloramphenicol | |
| Solid | |
| 5 to 7 | |
| Poly Bottle | |
| White | |
| 97% | |
| 15, 2077 | |
| WIIZWVCIJKGZOK-RKDXNWHRSA-N | |
| 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide | |
| 5959 | |
| 323.13 |
| Chloramphenicol | |
| 56-75-7 | |
| 149°C | |
| Inclusive between 17° (+ or -) | |
| 100 g | |
| C11H12Cl2N2O5 | |
| Chloromycetin, D-(?)-threo-2, 2-Dichloro-N-[?-hydroxy-?-(hydroxymethyl)-?-(4-nitrophenyl)ethyl]acetamide | |
| C1=CC(=CC=C1C(C(CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-] | |
| 323.126 | |
| CHEBI:17698 |
Chemical Identifiers
| 56-75-7 | |
| 323.126 | |
| Chloromycetin, D-(?)-threo-2, 2-Dichloro-N-[?-hydroxy-?-(hydroxymethyl)-?-(4-nitrophenyl)ethyl]acetamide | |
| CHEBI:17698 | |
| C1=CC(=CC=C1C(C(CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-] |
| C11H12Cl2N2O5 | |
| WIIZWVCIJKGZOK-RKDXNWHRSA-N | |
| 5959 | |
| 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide |
Safety and Handling
WARNING!
Emergency Overview
Suspect cancer hazard. May cause skin, eye, and respiratory tract irritation. Use personal protective equipment. Use only under a chemical fume hood. Wash off immediately with plenty of water for at least 15 minutes. Immediate medical attention is required. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Immediate medical attention is required. Move to fresh air. If breathing is difficult, give oxygen. Do not use mouth-to-mouth resuscitation if victim ingested or inhaled the substance; induce artifici. Immediate medical attention is required. Immediate medical attention is required. Do not induce vomiting.
NFPA
Health:2
Flammability:0
Instability:0
Recommended Storage : RT