missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Carboxymethyl Cellulose Sodium Salt, Medium Viscosity, MP Biomedicals
Supplier: MP Biomedicals Inc 0215056090
| Quantity | 500 g |
|---|
Chemical Identifiers
| (C12 H14 O9 R6)n | |
| MFCD00081472 | |
| carboxymethylcellulose sodium usp, celluvisc tn, carmellose sodium jp17, sodium dextrose acetate, c.m.c. tn | |
| [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O |
Specifications
| Carboxymethyl cellulose sodium salt | |
| White | |
| 500 g | |
| carboxymethylcellulose sodium usp, celluvisc tn, carmellose sodium jp17, sodium dextrose acetate, c.m.c. tn | |
| [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O | |
| 263.20 | |
| Powder |
| 9004-32-4 | |
| (C12 H14 O9 R6)n | |
| MFCD00081472 | |
| DPXJVFZANSGRMM-UHFFFAOYNA-N | |
| sodium;2,3,4,5,6-pentahydroxyhexanal;acetate | |
| 23706213 |
Safety and Handling
Recommended Storage : Store at Room Temperature (15 to 30°C).