Learn More
Carbenicillin (Disodium Salt), Fisher BioReagents
Supplier: Fisher BioReagents BP2648250
Description
Used for the selection of ampicillin-resistant transformed cells and for the study of penicillin-sensitive transpeptidases in cell wall biosynthesis. Antimicrobial spectrum: Gram-positive and Gram-negative bacteria, Pseudomonas.Specifications
| Carbenicillin | |
| Disodium Salt | |
| 4800-94-6 | |
| Amber Glass | |
| 6% Max. | |
| 250 mg | |
| C17H16N2Na2O6S | |
| 738°C | |
| RTYJTGSCYUUYAL-YCAHSCEMSA-L | |
| disodium (2S,5R,6R)-6-(2-carboxylato-2-phenylacetamido)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | |
| 20933 | |
| 422.4 |
| Carbenicillin | |
| Solid | |
| 200°C | |
| 770μg/mg min. | |
| White | |
| ≥92 % | |
| MFCD00077683 | |
| α-Carboxybenzylpenicillin | |
| [Na+].[Na+].CC1(C)S[C@@H]2[C@H](NC(=O)C(C([O-])=O)C3=CC=CC=C3)C(=O)N2[C@H]1C([O-])=O | |
| 422.36 | |
| CHEBI:34609 | |
| 92% min. |
Chemical Identifiers
| 4800-94-6 | |
| 422.36 | |
| RTYJTGSCYUUYAL-YCAHSCEMSA-L | |
| 20933 | |
| disodium (2S,5R,6R)-6-(2-carboxylato-2-phenylacetamido)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| C17H16N2Na2O6S | |
| MFCD00077683 | |
| α-Carboxybenzylpenicillin | |
| CHEBI:34609 | |
| [Na+].[Na+].CC1(C)S[C@@H]2[C@H](NC(=O)C(C([O-])=O)C3=CC=CC=C3)C(=O)N2[C@H]1C([O-])=O |
Safety and Handling
WARNING!
Emergency Overview
May cause allergic respiratory and skin reaction. Use personal protective equipment. Use only under a chemical fume hood. Wash off immediately with plenty of water for at least 15 minutes. Immediate medical attention is required. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Immediate medical attention is required. Move to fresh air. If breathing is difficult, give oxygen. Do not use mouth-to-mouth resuscitation if victim ingested or inhaled the substance; induce artifici. Immediate medical attention is required. Do not induce vomiting. Do not induce vomiting. Call a physician or Poison Control Center immediately.
NFPA
Health:2
Flammability:0
Instability:0
Recommended Storage : 0° to 5°C