missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Calmagite Indicator, 0.1% Aqueous, for Hardness, Certified, LabChem™
$40.82 - $81.11
Chemical Identifiers
| CAS | 3147-14-6 |
|---|---|
| Molecular Formula | C17H14N2O5S |
| Molecular Weight (g/mol) | 358.368 |
| InChI Key | ASFVMSDYPYMUFL-UHFFFAOYSA-N |
| PubChem CID | 6364506 |
| IUPAC Name | 4-[(2-hydroxy-5-methylphenyl)hydrazinylidene]-3-oxonaphthalene-1-sulfonic acid |
| SMILES | CC1=CC(=C(C=C1)O)NN=C2C3=CC=CC=C3C(=CC2=O)S(=O)(=O)O |
Chemical Identifiers
| 3147-14-6 | |
| 358.368 | |
| 6364506 | |
| CC1=CC(=C(C=C1)O)NN=C2C3=CC=CC=C3C(=CC2=O)S(=O)(=O)O |
| C17H14N2O5S | |
| ASFVMSDYPYMUFL-UHFFFAOYSA-N | |
| 4-[(2-hydroxy-5-methylphenyl)hydrazinylidene]-3-oxonaphthalene-1-sulfonic acid |
Specifications
| 3147-14-6 , 7732-18-5 | |
| C17H14N2O5S | |
| Soluble in water | |
| ASFVMSDYPYMUFL-UHFFFAOYSA-N | |
| 4-[(2-hydroxy-5-methylphenyl)hydrazinylidene]-3-oxonaphthalene-1-sulfonic acid | |
| 6364506 | |
| Certified | |
| 1g/mL | |
| Nitrogen oxides; Carbon monoxide; Carbon dioxide | |
| 125 mL | |
| Calmagite Indicator, 0.1% Aqueous, for Hardness |
| 99.9,0.1 | |
| C17H14N2O5S | |
| Passes Test | |
| CC1=CC(=C(C=C1)O)NN=C2C3=CC=CC=C3C(=CC2=O)S(=O)(=O)O | |
| 358.368 | |
| 358.37 | |
| Poly Bottle | |
| Passes Test | |
| 1g/mL | |
| Liquid |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature